| 1 | // This may look like C code, but it is really -*- C++ -*- | 
|---|
| 2 | // Classe d'interface avec le code de GNUplot | 
|---|
| 3 | // pour calculer les contours & classe de trace de contours | 
|---|
| 4 | // O. Perdereau | 
|---|
| 5 | // LAL (Orsay) / IN2P3-CNRS  DAPNIA/SPP (Saclay) / CEA | 
|---|
| 6 |  | 
|---|
| 7 | #include "sopnamsp.h" | 
|---|
| 8 | #include "machdefs.h" | 
|---|
| 9 | #include <stdio.h> | 
|---|
| 10 | #include <stdlib.h> | 
|---|
| 11 | #include <assert.h> | 
|---|
| 12 | #include <iostream> | 
|---|
| 13 | #include <math.h> | 
|---|
| 14 |  | 
|---|
| 15 | #include "histos.h" | 
|---|
| 16 | #include "ntuple.h" | 
|---|
| 17 |  | 
|---|
| 18 | #include "nbtri.h" | 
|---|
| 19 |  | 
|---|
| 20 | #include "picntools.h" | 
|---|
| 21 | #include "pigncont.h" | 
|---|
| 22 |  | 
|---|
| 23 | #include <sys/time.h> | 
|---|
| 24 | #include <sys/resource.h> | 
|---|
| 25 |  | 
|---|
| 26 | //++ | 
|---|
| 27 | // Class        GNUPlotContour | 
|---|
| 28 | // Lib          PIGcont | 
|---|
| 29 | // include      pigncont.h | 
|---|
| 30 | // | 
|---|
| 31 | //      Classe d'interface avec le code de GNUplot qui calcule les courbes de niveaux | 
|---|
| 32 | //      GNUplot part d'une grille (structure iso_curve) qui est remplie par les | 
|---|
| 33 | //      createurs | 
|---|
| 34 | //      Les parametres du calcul sont modifiable a partir de la fenetre d'options | 
|---|
| 35 | //      du traceur de contour (classe PIContourDrawer) | 
|---|
| 36 | //      Options (reconnues dans un enum t_contour_kind dans GNUplot) | 
|---|
| 37 | // | 
|---|
| 38 | //       1) nombre de courbes et et niveaux determines automatiquement par le programme (defaut) | 
|---|
| 39 | //          En general, 5 courbes sont tracees LEVELS_AUTO | 
|---|
| 40 | // | 
|---|
| 41 | //       2) nombre de niveaux fixe par l'utilisateur. Les niveaux sont equidistants entre | 
|---|
| 42 | //          le min et le max de la surface LEVELS_NUM | 
|---|
| 43 | // | 
|---|
| 44 | //       3) nombre et hauteurs des niveaux fixes par l'utilisateur. Les niveaux sont passes | 
|---|
| 45 | //          dans un tableau LEVELS_DISCRETE | 
|---|
| 46 | // | 
|---|
| 47 | //       4) nombre niveau min et ecart entre niveaux fixe par l'utilisateur LEVELS_INCREMENTAL | 
|---|
| 48 | // | 
|---|
| 49 | //     Les contours sont traces en interpolant entre les points de la grille. | 
|---|
| 50 | //     On peut choisir 3 algorithmes d'interpolation a travers p.ex. les options | 
|---|
| 51 | //     de PIContourDrawer | 
|---|
| 52 | //     (enum t_contour_levels_kind ds GNUplot) | 
|---|
| 53 | // | 
|---|
| 54 | //       a) interpolation simple CONTOUR_KIND_LINEAR | 
|---|
| 55 | // | 
|---|
| 56 | //       b) spline cubique       CONTOUR_KIND_CUBIC_SPL | 
|---|
| 57 | // | 
|---|
| 58 | //       c) B-spline             CONTOUR_KIND_BSPLINE | 
|---|
| 59 | // | 
|---|
| 60 | //-- | 
|---|
| 61 | //++ | 
|---|
| 62 | // Links        Voir aussi | 
|---|
| 63 | // PIContourDrawer | 
|---|
| 64 | // PICnTools | 
|---|
| 65 | //-- | 
|---|
| 66 | //++ | 
|---|
| 67 | // Titre        Constructeurs et Méthodes | 
|---|
| 68 | //-- | 
|---|
| 69 | //++ | 
|---|
| 70 | // GNUPlotContour(struct iso_curve * iso) : | 
|---|
| 71 | //         constructeur a partir d'une structure iso_curve | 
|---|
| 72 | //         (structure de GNUplot) | 
|---|
| 73 | //-- | 
|---|
| 74 |  | 
|---|
| 75 |  | 
|---|
| 76 | GNUPlotContour::GNUPlotContour(struct iso_curve * iso){ | 
|---|
| 77 | int k=0; | 
|---|
| 78 | iso1 = iso; | 
|---|
| 79 | struct iso_curve *iso_cur = iso ; | 
|---|
| 80 | struct iso_curve *iso_old; | 
|---|
| 81 | _xmin = 1.e37; | 
|---|
| 82 | _ymin = 1.e37; | 
|---|
| 83 | _xmax = -1.e37; | 
|---|
| 84 | _ymax = -1.e37; | 
|---|
| 85 | _myiso = NULL; | 
|---|
| 86 | _zmin = 1.e37; | 
|---|
| 87 | _zmax = -1.e37; | 
|---|
| 88 | while(iso_cur){ | 
|---|
| 89 | k++; | 
|---|
| 90 | iso_cur = iso_cur->next; | 
|---|
| 91 | _ny = iso_cur->p_count; | 
|---|
| 92 | for(int k=0 ; k<_ny ; k++){ | 
|---|
| 93 | double xx=iso->points[k].x; | 
|---|
| 94 | double yy=iso->points[k].y; | 
|---|
| 95 | double zz=iso->points[k].z; | 
|---|
| 96 | if(xx<_xmin) _xmin = xx; | 
|---|
| 97 | if(xx>_xmax) _xmax = xx; | 
|---|
| 98 | if(yy<_ymin) _ymin = yy; | 
|---|
| 99 | if(yy>_ymax) _ymax = yy; | 
|---|
| 100 | if(zz<_zmin) _zmin = zz; | 
|---|
| 101 | if(zz>_zmax) _zmax = zz; | 
|---|
| 102 |  | 
|---|
| 103 | } | 
|---|
| 104 | } | 
|---|
| 105 |  | 
|---|
| 106 | _nx = k; | 
|---|
| 107 | _contours = NULL; | 
|---|
| 108 | My_Levels = NULL; | 
|---|
| 109 |  | 
|---|
| 110 | _npolys=-1; | 
|---|
| 111 | _Dxp =_Dyp =1.; | 
|---|
| 112 | _Exy =_Invy =_Invy = FALSE ; | 
|---|
| 113 |  | 
|---|
| 114 | } | 
|---|
| 115 |  | 
|---|
| 116 |  | 
|---|
| 117 | //++ | 
|---|
| 118 | // GNUPlotContour(NTupleInterface *nt,int *nz=NULL,double *z=NULL,double *dz=NULL): | 
|---|
| 119 | //         constructeur a partir d'un NTupleInterface | 
|---|
| 120 | //         la structure iso_curve est remplie par le constructeur | 
|---|
| 121 | //Inputs | 
|---|
| 122 | //| NTupleInterface *nt | 
|---|
| 123 | //| double *nz nombre de contours (optionnel) | 
|---|
| 124 | //| double *z tabelau avec les niveaux des contours (optionnel) | 
|---|
| 125 | //| double *dz increment entre contours (optionnel) | 
|---|
| 126 | //-- | 
|---|
| 127 | GNUPlotContour::GNUPlotContour(NTupleInterface *nt,int *nz=NULL,double *z=NULL,double *dz=NULL){ | 
|---|
| 128 | _xmin = 1.e37; | 
|---|
| 129 | _ymin = 1.e37; | 
|---|
| 130 | _xmax = -1.e37; | 
|---|
| 131 | _ymax = -1.e37; | 
|---|
| 132 | _zmin = 1.e37; | 
|---|
| 133 | _zmax = -1.e37; | 
|---|
| 134 | char *nom[4]={"x","y","z","niso"}; | 
|---|
| 135 | _myiso = new NTuple(4,nom); | 
|---|
| 136 | //_myiso->Show(); | 
|---|
| 137 | float xnt[4]; | 
|---|
| 138 | double mn,mx; | 
|---|
| 139 |  | 
|---|
| 140 | nt->GetMinMax(0,_xmin,_xmax); | 
|---|
| 141 | nt->GetMinMax(1,_ymin,_ymax); | 
|---|
| 142 | nt->GetMinMax(2,_zmin,_zmax); | 
|---|
| 143 |  | 
|---|
| 144 |  | 
|---|
| 145 | struct iso_curve *istmp = NULL ; | 
|---|
| 146 | struct iso_curve *iso = NULL ; | 
|---|
| 147 | struct iso_curve *iso_old = NULL ; | 
|---|
| 148 | double x,y; | 
|---|
| 149 | int nen = nt->NbLines(); | 
|---|
| 150 |  | 
|---|
| 151 | // histo des y | 
|---|
| 152 | for(int k= 0 ; k<1000 ; k++){ | 
|---|
| 153 | istmp = iso_alloc(100); | 
|---|
| 154 | iso_free(istmp); | 
|---|
| 155 | } | 
|---|
| 156 |  | 
|---|
| 157 | #define NUMPTMIN 25 | 
|---|
| 158 | #define MAXISO 100 | 
|---|
| 159 | #define MINISO 5 | 
|---|
| 160 |  | 
|---|
| 161 | Histo prep(_ymin,_ymax,nen); | 
|---|
| 162 | for(int ix=0 ; ix<nen ; ix++) prep.Add(nt->GetCell(ix,1),1.); | 
|---|
| 163 | Histo Intg = prep; | 
|---|
| 164 | Intg.HInteg(0); | 
|---|
| 165 | //prep.Print(); | 
|---|
| 166 | //Intg.Print(); | 
|---|
| 167 | float *bin; | 
|---|
| 168 | int *cnt; | 
|---|
| 169 |  | 
|---|
| 170 | int niso = sqrt( (double)nen); | 
|---|
| 171 | bin = new float[niso+1]; | 
|---|
| 172 | cnt = new int[niso+1]; | 
|---|
| 173 |  | 
|---|
| 174 | int i; | 
|---|
| 175 | for(i=0 ; i<niso ; i++){ | 
|---|
| 176 | bin[i] = prep.BinHighEdge(prep.BinPercent( ((double)i)/(double)niso)); | 
|---|
| 177 | cnt[i] = Intg(prep.BinPercent( ((double)i)/(double)niso)); | 
|---|
| 178 | } | 
|---|
| 179 |  | 
|---|
| 180 | bin[niso]=_ymax; | 
|---|
| 181 |  | 
|---|
| 182 | cnt[niso] = prep.NEntries(); | 
|---|
| 183 | int numx = 0; | 
|---|
| 184 | int numi = 9999; | 
|---|
| 185 | for(i=0;i<niso ; i++){ | 
|---|
| 186 | int numy = cnt[i+1]-cnt[i]; | 
|---|
| 187 |  | 
|---|
| 188 | if(numy>0){ | 
|---|
| 189 | numx = numx>numy ? numx : numy ; | 
|---|
| 190 | numi = numy>numi ? numi : numy ; | 
|---|
| 191 | } | 
|---|
| 192 | } | 
|---|
| 193 |  | 
|---|
| 194 |  | 
|---|
| 195 | if (numi<=0) { | 
|---|
| 196 |  | 
|---|
| 197 | return; | 
|---|
| 198 | } | 
|---|
| 199 | _nx = 0; | 
|---|
| 200 |  | 
|---|
| 201 | for(i=0;i<niso ; i++){ | 
|---|
| 202 | double ymi = bin[i]; | 
|---|
| 203 | double ymx = bin[i+1]; | 
|---|
| 204 | int numy = cnt[i+1]-cnt[i]; | 
|---|
| 205 |  | 
|---|
| 206 | if(numy<=0) continue; | 
|---|
| 207 | double *xp; | 
|---|
| 208 | xp = new double[numy]; | 
|---|
| 209 |  | 
|---|
| 210 | int *indx; | 
|---|
| 211 | indx = new int[numy]; | 
|---|
| 212 |  | 
|---|
| 213 | istmp = iso_alloc(numy) ; // structure temporaire | 
|---|
| 214 |  | 
|---|
| 215 | int ip=0; | 
|---|
| 216 | int ix; | 
|---|
| 217 | for(ix=0 ; ix<nen ; ix++){ | 
|---|
| 218 |  | 
|---|
| 219 | if(nt->GetCell(ix,1)>=ymi&&nt->GetCell(ix,1)<ymx){ | 
|---|
| 220 |  | 
|---|
| 221 |  | 
|---|
| 222 | istmp->points[ip].type = INRANGE; | 
|---|
| 223 | istmp->points[ip].x = nt->GetCell(ix,0); | 
|---|
| 224 | istmp->points[ip].y = nt->GetCell(ix,1); | 
|---|
| 225 | istmp->points[ip].z = nt->GetCell(ix,2); | 
|---|
| 226 | indx[ip] = ip; | 
|---|
| 227 | xp[ip++] = nt->GetCell(ix,0); | 
|---|
| 228 | } | 
|---|
| 229 | } | 
|---|
| 230 |  | 
|---|
| 231 | // tri des points de l'iso_curve | 
|---|
| 232 | // | 
|---|
| 233 | istmp->p_count = ip; | 
|---|
| 234 |  | 
|---|
| 235 | tri_double(xp,indx,ip); | 
|---|
| 236 |  | 
|---|
| 237 | // remplissage structure finale | 
|---|
| 238 |  | 
|---|
| 239 | iso = iso_alloc(numx) ; | 
|---|
| 240 | if( _nx == 0 ) iso1 = iso; //premiere structure remplie | 
|---|
| 241 | if (iso_old) iso_old->next = iso; | 
|---|
| 242 | for(ix=0 ; ix<numy   ; ix++){ | 
|---|
| 243 | int jx = indx[ix]; | 
|---|
| 244 |  | 
|---|
| 245 |  | 
|---|
| 246 | iso->points[ix].type = INRANGE ; | 
|---|
| 247 | iso->points[ix].x = istmp->points[jx].x ; | 
|---|
| 248 | iso->points[ix].y = istmp->points[jx].y ; | 
|---|
| 249 | iso->points[ix].z = istmp->points[jx].z ; | 
|---|
| 250 | xnt[0] = iso->points[ix].x; | 
|---|
| 251 | xnt[1] = iso->points[ix].y; | 
|---|
| 252 | xnt[2] = iso->points[ix].z; | 
|---|
| 253 | xnt[3] = _nx; | 
|---|
| 254 | //cout << " fill avec "<<xnt[0]<<"  "<<xnt[1] <<" "<<xnt[2] << " "<<xnt[3]<<endl; | 
|---|
| 255 | // _myiso->Show(); | 
|---|
| 256 |  | 
|---|
| 257 | _myiso->Fill(xnt); | 
|---|
| 258 | } | 
|---|
| 259 | //cout << " completion "<<ip<<" =>> "<<numx<<endl; | 
|---|
| 260 | // on complete | 
|---|
| 261 | for(ix=ip; ix<numx ; ix++ ){ | 
|---|
| 262 | int jmx = indx[ip-1]; | 
|---|
| 263 | iso->points[ix].type = INRANGE ; | 
|---|
| 264 | iso->points[ix].x = istmp->points[jmx].x ; | 
|---|
| 265 | iso->points[ix].y = istmp->points[jmx].y ; | 
|---|
| 266 | iso->points[ix].z = istmp->points[jmx].z ; | 
|---|
| 267 | xnt[0] = iso->points[ix].x; | 
|---|
| 268 | xnt[1] = iso->points[ix].y; | 
|---|
| 269 | xnt[2] = iso->points[ix].z; | 
|---|
| 270 | xnt[3] = _nx; | 
|---|
| 271 | //cout << " fill avec "<<xnt[0]<<"  "<<xnt[1] <<" "<<xnt[2] << " "<<xnt[3]<<endl; | 
|---|
| 272 | _myiso->Fill(xnt); | 
|---|
| 273 | //_myiso->Show(); | 
|---|
| 274 | } | 
|---|
| 275 |  | 
|---|
| 276 | iso->p_count = numx; | 
|---|
| 277 |  | 
|---|
| 278 | iso_old = iso; | 
|---|
| 279 | _nx++; | 
|---|
| 280 | //cout << " destruction structure tempo "<<_nx <<endl; | 
|---|
| 281 | if(istmp){ | 
|---|
| 282 | iso_free( istmp );// destruction de la structure temporaire | 
|---|
| 283 | istmp = NULL; | 
|---|
| 284 | } | 
|---|
| 285 | if(xp){delete[] xp ; xp=NULL;} | 
|---|
| 286 | if(indx) {delete[] indx ; indx = NULL;} | 
|---|
| 287 |  | 
|---|
| 288 | } | 
|---|
| 289 | //if(_myiso!=NULL)_myiso->Write("myiso.ppf"); | 
|---|
| 290 | //cout << " fin du remplissage des iso_curves xmin,max "<< _xmin<<","<<_xmax<<" ymin,max "<<_ymin<<","<<_ymax<<endl; | 
|---|
| 291 | _contours = NULL; | 
|---|
| 292 | My_Levels = NULL; | 
|---|
| 293 | _npolys=-1; | 
|---|
| 294 | Contour_Levels_kind = LEVELS_AUTO ; | 
|---|
| 295 | Contour_kind = CONTOUR_KIND_LINEAR ; | 
|---|
| 296 | set_contour_kind(Contour_kind); | 
|---|
| 297 | Contour_Levels = 5; | 
|---|
| 298 | set_contour_levels(Contour_Levels); | 
|---|
| 299 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 300 |  | 
|---|
| 301 |  | 
|---|
| 302 | if(dz!=NULL){ | 
|---|
| 303 | My_Levels = new double[2]; | 
|---|
| 304 | Contour_Levels = *nz; | 
|---|
| 305 | My_Levels[0] = *z ; | 
|---|
| 306 | My_Levels[1] = *dz; | 
|---|
| 307 | Contour_Levels_kind = LEVELS_INCREMENTAL ; | 
|---|
| 308 | set_contour_levels(Contour_Levels); | 
|---|
| 309 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 310 | set_contour_levels_list(My_Levels);//,2); | 
|---|
| 311 |  | 
|---|
| 312 | }else  if(nz!=NULL){ | 
|---|
| 313 |  | 
|---|
| 314 | Contour_Levels = *nz; | 
|---|
| 315 | Contour_Levels_kind = LEVELS_NUM ; | 
|---|
| 316 | set_contour_levels(Contour_Levels); | 
|---|
| 317 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 318 | } | 
|---|
| 319 |  | 
|---|
| 320 | } | 
|---|
| 321 |  | 
|---|
| 322 | //++ | 
|---|
| 323 | // GNUPlotContour(P2DArrayAdapter*arr,int *nz=NULL,double *z=NULL,double *dz=NULL): | 
|---|
| 324 | //         constructeur a partir d'un P2DArrayAdapter | 
|---|
| 325 | //         la structure iso_curve est remplie par le constructeur | 
|---|
| 326 | //Inputs | 
|---|
| 327 | //| P2DArrayAdapter* arr | 
|---|
| 328 | //| double *nz nombre de contours (optionnel) | 
|---|
| 329 | //| double *z tabelau avec les niveaux des contours (optionnel) | 
|---|
| 330 | //| double *dz increment entre contours (optionnel) | 
|---|
| 331 | //-- | 
|---|
| 332 |  | 
|---|
| 333 | GNUPlotContour::GNUPlotContour(P2DArrayAdapter* arr,int *nz=NULL,double *z=NULL,double *dz=NULL){ | 
|---|
| 334 | _xmin = 1.e37; | 
|---|
| 335 | _ymin = 1.e37; | 
|---|
| 336 | _xmax = -1.e37; | 
|---|
| 337 | _ymax = -1.e37; | 
|---|
| 338 | _zmin = 1.e37; | 
|---|
| 339 | _zmax = -1.e37; | 
|---|
| 340 | // _nx = arr->XSize()-1; | 
|---|
| 341 | // _ny = arr->YSize()-1; | 
|---|
| 342 | _nx = arr->XSize()  ; | 
|---|
| 343 | _ny = arr->YSize()  ; | 
|---|
| 344 | //cout << " size x,y "<<_nx<<" , "<<_ny <<endl; | 
|---|
| 345 | char *nom[4]={"x","y","z","niso"}; | 
|---|
| 346 |  | 
|---|
| 347 | _myiso = new NTuple(4,nom); | 
|---|
| 348 | float xnt[4]; | 
|---|
| 349 | struct iso_curve *iso =NULL ; | 
|---|
| 350 | struct iso_curve *iso_old =NULL ; | 
|---|
| 351 | double x,y; | 
|---|
| 352 | // Calcul de la taille en X et en Y d'un pixel | 
|---|
| 353 | double dxp, dyp; | 
|---|
| 354 | double x1,y1; | 
|---|
| 355 | arr->XYfromxy(0,0,x,y); | 
|---|
| 356 | arr->XYfromxy(1,1,x1,y1); | 
|---|
| 357 | _Dxp = (x1-x); | 
|---|
| 358 | _Dyp = (y1-y); | 
|---|
| 359 | double zz; | 
|---|
| 360 | for(int ix=0 ; ix<_nx ; ix++){ | 
|---|
| 361 | iso = iso_alloc(_ny) ; | 
|---|
| 362 | if(ix==0) iso1 = iso; | 
|---|
| 363 | if (iso_old) iso_old->next = iso; | 
|---|
| 364 | for(int iy = 0 ; iy<_ny ; iy++){ | 
|---|
| 365 | /*i = ix*100+iy;*/ | 
|---|
| 366 | arr->XYfromxy(ix,iy,x,y); | 
|---|
| 367 |  | 
|---|
| 368 | iso->points[iy].type = INRANGE; | 
|---|
| 369 | iso->points[iy].x = x + _Dxp/2.; | 
|---|
| 370 | iso->points[iy].y = y + _Dyp/2.; | 
|---|
| 371 | zz=arr->Value(ix,iy); | 
|---|
| 372 | iso->points[iy].z = zz; | 
|---|
| 373 | //iso->points[iy].z = ((x-25)*(x-25) + (y-25)*(y-25))*.05 ; | 
|---|
| 374 | if(x <_xmin) _xmin = x; | 
|---|
| 375 | if(x >_xmax) _xmax = x; | 
|---|
| 376 | if(y <_ymin) _ymin = y; | 
|---|
| 377 | if(y >_ymax) _ymax = y; | 
|---|
| 378 | if(zz <_zmin) _zmin = zz; | 
|---|
| 379 | if(zz >_zmax) _zmax = zz; | 
|---|
| 380 | //printf("ix=%d iy=%d x=%f y=%f z=%f \n",ix,iy,iso->points[iy].x,iso->points[iy].y,iso->points[iy].z); | 
|---|
| 381 | xnt[0] = iso->points[iy].x; | 
|---|
| 382 | xnt[1] = iso->points[iy].y; | 
|---|
| 383 | xnt[2] = iso->points[iy].z; | 
|---|
| 384 | xnt[3] = _nx; | 
|---|
| 385 |  | 
|---|
| 386 | _myiso->Fill(xnt); | 
|---|
| 387 | } | 
|---|
| 388 | iso->p_count = _ny; | 
|---|
| 389 | iso_old = iso; | 
|---|
| 390 | /*printf(" remplissage %lx old %lx old next %lx \n",iso,iso_old,iso->next,iso_old->next);*/ | 
|---|
| 391 | /*iso->next = iso ;*/ | 
|---|
| 392 | } | 
|---|
| 393 | //cout << " fin du remplissage des iso_curves xmin,max "<< _xmin<<","<<_xmax<<" ymin,max "<<_ymin<<","<<_ymax<<endl; | 
|---|
| 394 | _contours = NULL; | 
|---|
| 395 | My_Levels = NULL; | 
|---|
| 396 | _npolys=-1; | 
|---|
| 397 | Contour_kind = CONTOUR_KIND_LINEAR ; | 
|---|
| 398 | set_contour_kind(Contour_kind); | 
|---|
| 399 | Contour_Levels_kind = LEVELS_AUTO ; | 
|---|
| 400 | Contour_Levels = 5; | 
|---|
| 401 | set_contour_levels(Contour_Levels); | 
|---|
| 402 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 403 |  | 
|---|
| 404 |  | 
|---|
| 405 | if(dz!=NULL){ | 
|---|
| 406 | My_Levels = new double[2]; | 
|---|
| 407 | Contour_Levels = *nz; | 
|---|
| 408 | My_Levels[0] = *z ; | 
|---|
| 409 | My_Levels[1] = *dz; | 
|---|
| 410 | Contour_Levels_kind = LEVELS_INCREMENTAL ; | 
|---|
| 411 | set_contour_levels(Contour_Levels); | 
|---|
| 412 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 413 | set_contour_levels_list(My_Levels);//,2); | 
|---|
| 414 |  | 
|---|
| 415 | }else  if(nz!=NULL){ | 
|---|
| 416 | Contour_Levels = *nz; | 
|---|
| 417 | Contour_Levels_kind = LEVELS_NUM ; | 
|---|
| 418 | set_contour_levels(Contour_Levels); | 
|---|
| 419 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 420 | } | 
|---|
| 421 |  | 
|---|
| 422 | } | 
|---|
| 423 |  | 
|---|
| 424 |  | 
|---|
| 425 | //++ | 
|---|
| 426 | // ~GNUPlotContour() | 
|---|
| 427 | // | 
|---|
| 428 | //       Destructeur | 
|---|
| 429 | // | 
|---|
| 430 | //-- | 
|---|
| 431 | GNUPlotContour::~GNUPlotContour(){ | 
|---|
| 432 | //cout << " destructeur de GNUPlotContour "<<endl; | 
|---|
| 433 |  | 
|---|
| 434 | struct iso_curve *iso_cur; | 
|---|
| 435 | struct iso_curve *iso_nx; | 
|---|
| 436 | iso_cur = iso1; | 
|---|
| 437 |  | 
|---|
| 438 | while(iso_cur){ | 
|---|
| 439 | // cout << " ~GNUPlotContour() : destruction de  iso1 "<< iso_cur << endl; | 
|---|
| 440 | iso_nx = iso_cur->next; | 
|---|
| 441 | iso_free(iso_cur);iso_cur = NULL; | 
|---|
| 442 |  | 
|---|
| 443 | iso_cur = iso_nx; | 
|---|
| 444 |  | 
|---|
| 445 | } | 
|---|
| 446 |  | 
|---|
| 447 | iso1 = NULL; | 
|---|
| 448 |  | 
|---|
| 449 | struct gnuplot_contours *cntcur = _contours; | 
|---|
| 450 | /***** | 
|---|
| 451 | struct gnuplot_contours *cntold; | 
|---|
| 452 |  | 
|---|
| 453 | while(cntcur) { | 
|---|
| 454 | //cout << " ~GNUPlotContour() : destruction de _contours" << _contours <<endl; | 
|---|
| 455 | cntold = cntcur; | 
|---|
| 456 | cntcur = cntold->next; | 
|---|
| 457 | gp_free(cntold); | 
|---|
| 458 | cntold=NULL; | 
|---|
| 459 | } | 
|---|
| 460 | *******/ | 
|---|
| 461 | contour_free(cntcur); | 
|---|
| 462 | _contours = NULL; | 
|---|
| 463 |  | 
|---|
| 464 | if(My_Levels) { | 
|---|
| 465 | //cout << " ~GNUPlotContour() : destruction de MyLevels "<<My_Levels <<endl; | 
|---|
| 466 | delete[] My_Levels; My_Levels=NULL;} | 
|---|
| 467 |  | 
|---|
| 468 | if(_myiso!=NULL){ delete _myiso; _myiso=NULL;} | 
|---|
| 469 |  | 
|---|
| 470 | } | 
|---|
| 471 |  | 
|---|
| 472 |  | 
|---|
| 473 | //++ | 
|---|
| 474 | // void CalcContour() | 
|---|
| 475 | //      Methode de calcul des courbes de niveaux | 
|---|
| 476 | //      par appel a la routine de GNUplot | 
|---|
| 477 | // | 
|---|
| 478 | //-- | 
|---|
| 479 | void GNUPlotContour::CalcContour(){ | 
|---|
| 480 | //cout << " GNUPlotContour::CalcContour(): determination des contours "<<endl; | 
|---|
| 481 |  | 
|---|
| 482 | struct rusage r_usage; | 
|---|
| 483 | int rcus; | 
|---|
| 484 |  | 
|---|
| 485 | set_contour_kind(Contour_kind); | 
|---|
| 486 | if(Contour_Levels_kind == LEVELS_INCREMENTAL){ | 
|---|
| 487 |  | 
|---|
| 488 | set_contour_levels(Contour_Levels); | 
|---|
| 489 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 490 | //free_contour_levels_list(); | 
|---|
| 491 | set_contour_levels_list(My_Levels);//,2); | 
|---|
| 492 |  | 
|---|
| 493 | }else  if(Contour_Levels_kind == LEVELS_DISCRETE ){ | 
|---|
| 494 | set_contour_levels(Contour_Levels); | 
|---|
| 495 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 496 | //free_contour_levels_list(); | 
|---|
| 497 | set_contour_levels_list(My_Levels);//,Contour_Levels); | 
|---|
| 498 |  | 
|---|
| 499 | }else  if(Contour_Levels_kind == LEVELS_NUM ){ | 
|---|
| 500 |  | 
|---|
| 501 | set_contour_levels(Contour_Levels); | 
|---|
| 502 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 503 | }else if(Contour_Levels_kind == LEVELS_AUTO){ | 
|---|
| 504 | Contour_Levels = 5; | 
|---|
| 505 | set_contour_levels(Contour_Levels); | 
|---|
| 506 | set_contour_levels_kind(Contour_Levels_kind); | 
|---|
| 507 | } | 
|---|
| 508 |  | 
|---|
| 509 |  | 
|---|
| 510 | //rcus = getrusage( RUSAGE_SELF , &r_usage); | 
|---|
| 511 |  | 
|---|
| 512 | //if(rcus==0) | 
|---|
| 513 | //  cout << " rusage -> "<<  r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl; | 
|---|
| 514 | //else | 
|---|
| 515 | //  perror("1er appel"); | 
|---|
| 516 |  | 
|---|
| 517 | if(_contours) { | 
|---|
| 518 | //cout << " GNUPlotContour::CalcContour(): destruction des contours "<<_contours<<endl; | 
|---|
| 519 | struct gnuplot_contours *cntcur = _contours; | 
|---|
| 520 | /****** | 
|---|
| 521 | struct gnuplot_contours *cntold; | 
|---|
| 522 | while(cntcur) { | 
|---|
| 523 | //cout << " GNUPlotContour::CalcContour(): destruction des contours "<< cntcur<<endl; | 
|---|
| 524 | cntold = cntcur; | 
|---|
| 525 | cntcur = cntold->next; | 
|---|
| 526 | gp_free(cntold); | 
|---|
| 527 | cntold = NULL; | 
|---|
| 528 | } | 
|---|
| 529 | ******/ | 
|---|
| 530 | contour_free(cntcur); | 
|---|
| 531 | _contours = NULL; | 
|---|
| 532 |  | 
|---|
| 533 | } | 
|---|
| 534 |  | 
|---|
| 535 | //struct gnuplot_contours *cntcur; | 
|---|
| 536 | //struct gnuplot_contours *cntold; | 
|---|
| 537 |  | 
|---|
| 538 |  | 
|---|
| 539 | //rcus = getrusage( RUSAGE_SELF , &r_usage); | 
|---|
| 540 | //if(rcus==0) | 
|---|
| 541 | //  cout << " rusage -> "<< r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl; | 
|---|
| 542 | //else | 
|---|
| 543 | //  perror("2d appel"); | 
|---|
| 544 |  | 
|---|
| 545 |  | 
|---|
| 546 | _contours = contour (_nx,iso1); | 
|---|
| 547 |  | 
|---|
| 548 |  | 
|---|
| 549 | //rcus = getrusage( RUSAGE_SELF , &r_usage); | 
|---|
| 550 | //if(rcus==0) | 
|---|
| 551 | //  cout << " rusage -> "<<  r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl; | 
|---|
| 552 | //else | 
|---|
| 553 | //  perror("3ieme appel"); | 
|---|
| 554 |  | 
|---|
| 555 | //free_contour_levels_list(); | 
|---|
| 556 |  | 
|---|
| 557 |  | 
|---|
| 558 | } | 
|---|
| 559 | //++ | 
|---|
| 560 | // void SetMyLevels(double *ptr,int k) | 
|---|
| 561 | //      Setting du tableau des niveaux des contours | 
|---|
| 562 | //Inputs | 
|---|
| 563 | //| int k : nombre de niveaux | 
|---|
| 564 | //| double *ptr : adresse du tableau des niveaux | 
|---|
| 565 | //-- | 
|---|
| 566 | void | 
|---|
| 567 | GNUPlotContour::SetMyLevels(double *ptr,int k){ | 
|---|
| 568 |  | 
|---|
| 569 | if(My_Levels!=NULL) delete My_Levels; | 
|---|
| 570 | My_Levels = new double[k]; | 
|---|
| 571 | for(int i=0 ; i<k ; i++)My_Levels[i] = ptr[i]; | 
|---|
| 572 | } | 
|---|
| 573 | //++ | 
|---|
| 574 | // void SetMyLevels(vector<double>vec) | 
|---|
| 575 | //      Setting du tableau des niveaux des contours | 
|---|
| 576 | //Inputs | 
|---|
| 577 | //| | 
|---|
| 578 | //| vector <double> vec  : vecteur des niveaux | 
|---|
| 579 | //-- | 
|---|
| 580 | void | 
|---|
| 581 | GNUPlotContour::SetMyLevels(vector <double> vec){ | 
|---|
| 582 |  | 
|---|
| 583 | if(My_Levels!=NULL) delete My_Levels; | 
|---|
| 584 | int sz = vec.size(); | 
|---|
| 585 | assert (sz>0); | 
|---|
| 586 |  | 
|---|
| 587 | My_Levels = new double[sz]; | 
|---|
| 588 | for(int i=0 ; i<sz ; i++) | 
|---|
| 589 | My_Levels[i] = vec[i]; | 
|---|
| 590 | } | 
|---|
| 591 |  | 
|---|
| 592 | //++ | 
|---|
| 593 | // Class        PIContourDrawer | 
|---|
| 594 | // Lib          PIGcont | 
|---|
| 595 | // include      pigncont.h | 
|---|
| 596 | // | 
|---|
| 597 | //      Classe de traceur de contour qui herite de PIDrawer et de GNUPlotContour | 
|---|
| 598 | //      elle gere les options graphiques generales (couleurs, lignes, fontes,...) | 
|---|
| 599 | //      les contours peuvent etre traces avec des lignes ou des markers | 
|---|
| 600 | //      on peut afficher les valeurs des niveaux des contours | 
|---|
| 601 | //      on peut demander a utiliser une table de couleur | 
|---|
| 602 | //      tout ca a travers la fenetre de controle associee (PICnTools) | 
|---|
| 603 | // | 
|---|
| 604 | //-- | 
|---|
| 605 | //++ | 
|---|
| 606 | // Links        Parents | 
|---|
| 607 | // PIDrawer | 
|---|
| 608 | // GNUPlotContour | 
|---|
| 609 | //-- | 
|---|
| 610 | //++ | 
|---|
| 611 | // Links        Voir aussi | 
|---|
| 612 | // PICnTools | 
|---|
| 613 | //-- | 
|---|
| 614 | //++ | 
|---|
| 615 | // Titre        Constructeurs et Méthodes | 
|---|
| 616 | //-- | 
|---|
| 617 | //++ | 
|---|
| 618 | // PIContourDrawer(P2DArrayAdapter* arr,bool autodel,int *nz,double *z0,double *dz ) | 
|---|
| 619 | // Constructeur a partir d'un P2DArrayAdapter* - voir le createur de GNUPlotContour | 
|---|
| 620 | // | 
|---|
| 621 | //-- | 
|---|
| 622 |  | 
|---|
| 623 | PIContourDrawer::PIContourDrawer(P2DArrayAdapter* arr,bool autodel,int *nz,double *z0,double *dz ) | 
|---|
| 624 | :GNUPlotContour(arr,nz,z0,dz) | 
|---|
| 625 |  | 
|---|
| 626 | { | 
|---|
| 627 | _arr = arr; | 
|---|
| 628 | _nti = NULL; | 
|---|
| 629 | _nz=5; | 
|---|
| 630 | if(nz!=NULL)_nz = *nz; | 
|---|
| 631 | _autodel = autodel; | 
|---|
| 632 |  | 
|---|
| 633 | // This drawer has specific control tools | 
|---|
| 634 | mFgSpecContWind = true; | 
|---|
| 635 | InitAtts(); | 
|---|
| 636 | } | 
|---|
| 637 |  | 
|---|
| 638 | //++ | 
|---|
| 639 | // PIContourDrawer(NTupleInterface* nti,bool autodel,int *nz,double *z0,double *dz ) | 
|---|
| 640 | // Constructeur a partir d'un NTupleInterface*  - voir le createur de GNUPlotContour | 
|---|
| 641 | // | 
|---|
| 642 | //-- | 
|---|
| 643 | PIContourDrawer::PIContourDrawer(NTupleInterface* nti,bool autodel,int *nz,double *z0,double *dz ) | 
|---|
| 644 | :GNUPlotContour(nti,nz,z0,dz) | 
|---|
| 645 |  | 
|---|
| 646 | { | 
|---|
| 647 | _arr = NULL; | 
|---|
| 648 | _nti = nti; | 
|---|
| 649 | _nz=5; | 
|---|
| 650 | if(nz!=NULL)_nz = *nz; | 
|---|
| 651 | _autodel = autodel; | 
|---|
| 652 | InitAtts(); | 
|---|
| 653 | } | 
|---|
| 654 |  | 
|---|
| 655 |  | 
|---|
| 656 |  | 
|---|
| 657 | /* --Methode-- */ | 
|---|
| 658 | PIContourDrawer::~PIContourDrawer() | 
|---|
| 659 | { | 
|---|
| 660 | if(_autodel){ | 
|---|
| 661 | if(_arr!=NULL){delete _arr; _arr=NULL;} | 
|---|
| 662 | if(_nti!=NULL){delete _nti ; _nti=NULL;} | 
|---|
| 663 | } | 
|---|
| 664 | DeactivateControlWindow(NULL); | 
|---|
| 665 | //if (mColorMap!=NULL){delete  mColorMap;  mColorMap=NULL;} | 
|---|
| 666 | } | 
|---|
| 667 |  | 
|---|
| 668 | /* --Methode-- */ | 
|---|
| 669 | void PIContourDrawer::Draw(PIGraphicUC* g, double xmin, double ymin, double xmax, double ymax) | 
|---|
| 670 | { | 
|---|
| 671 | // double xmin, double ymin, double xmax, double ymax LIMITES DE LA ZONE A REFRESHER | 
|---|
| 672 | //PIGrCoord * xx = new PIGrCoord[10]; | 
|---|
| 673 | //PIGrCoord * yy = new PIGrCoord[10]; | 
|---|
| 674 | PIGrCoord * xx =NULL; | 
|---|
| 675 | PIGrCoord * yy =NULL; | 
|---|
| 676 | PIGrCoord xa; | 
|---|
| 677 | PIGrCoord ya; | 
|---|
| 678 | char buff[64]; | 
|---|
| 679 | // On met les bons attributs graphiques | 
|---|
| 680 | //SelGraAtt(g); | 
|---|
| 681 | g->SaveGraphicAtt(); | 
|---|
| 682 | struct gnuplot_contours *cntcur; | 
|---|
| 683 | struct gnuplot_contours *cntold; | 
|---|
| 684 | cntcur = _contours; | 
|---|
| 685 |  | 
|---|
| 686 | double a,b; | 
|---|
| 687 | int tot=0; | 
|---|
| 688 | bool Invx, Invy, Exy; | 
|---|
| 689 | PIColorMap * cmap = NULL; | 
|---|
| 690 | CMapId mcmapid = GetGraphicAtt().GetColMapId(); | 
|---|
| 691 | if(mcmapid !=CMAP_OTHER ){ | 
|---|
| 692 | cmap = new PIColorMap(mcmapid); | 
|---|
| 693 | } | 
|---|
| 694 | int numdr = 0; | 
|---|
| 695 | while(cntcur){ | 
|---|
| 696 | int npts = cntcur->num_pts ; | 
|---|
| 697 | if(npts<0) continue; | 
|---|
| 698 |  | 
|---|
| 699 | xx = new PIGrCoord[npts]; | 
|---|
| 700 | yy = new PIGrCoord[npts]; | 
|---|
| 701 | double lev = (cntcur->coords)[0].z ; | 
|---|
| 702 | for(int l=0 ; l< npts ; l++){ | 
|---|
| 703 | a = (cntcur->coords)[l].x; | 
|---|
| 704 | b = (cntcur->coords)[l].y; | 
|---|
| 705 |  | 
|---|
| 706 | xx[l] = a ; | 
|---|
| 707 | yy[l] = b ; | 
|---|
| 708 |  | 
|---|
| 709 | } | 
|---|
| 710 |  | 
|---|
| 711 | // choix de la couleur | 
|---|
| 712 |  | 
|---|
| 713 | g->SelForeground(GetGraphicAtt().GetFgColor()); | 
|---|
| 714 | if(mcmapid !=CMAP_OTHER ){ | 
|---|
| 715 | if(_zmax-_zmin!=0){ | 
|---|
| 716 | int kc = ((lev - _zmin)/(_zmax-_zmin))*cmap->NCol(); | 
|---|
| 717 |  | 
|---|
| 718 | g->SelForeground(*cmap,kc); | 
|---|
| 719 | } | 
|---|
| 720 | } | 
|---|
| 721 | // traitement des  des markers | 
|---|
| 722 | if(IsMarkOn()==true){ | 
|---|
| 723 |  | 
|---|
| 724 | g->SelMarker(GetGraphicAtt().GetMarkerSz(), GetGraphicAtt().GetMarker()); | 
|---|
| 725 | g->DrawMarkers(xx,yy,npts); | 
|---|
| 726 | } | 
|---|
| 727 | // traitement des lignes | 
|---|
| 728 | if(mLineOn==true){ | 
|---|
| 729 |  | 
|---|
| 730 | g->SelLine(GetGraphicAtt().GetLineAtt()); | 
|---|
| 731 | g->DrawPolygon(xx,yy,npts,false); | 
|---|
| 732 | } | 
|---|
| 733 | // traitement des labels | 
|---|
| 734 | // SIMPLISTE POUR L'INSTANT : UN AFFICHAGE | 
|---|
| 735 | if(mLabelOn==true){ | 
|---|
| 736 | // | 
|---|
| 737 |  | 
|---|
| 738 | char strg[10]; | 
|---|
| 739 | sprintf(strg,"%g",lev); | 
|---|
| 740 | PIFont myfont(GetGraphicAtt().GetFont()); | 
|---|
| 741 |  | 
|---|
| 742 | g->SelFont(myfont); | 
|---|
| 743 | double px,py; | 
|---|
| 744 | px = (cntcur->coords)[0].x+2*(Xmax()-Xmin())/100.; | 
|---|
| 745 | py = (cntcur->coords)[0].y; | 
|---|
| 746 | g->DrawString(px,py,strg, PI_HorizontalCenter&&PI_VerticalCenter ); | 
|---|
| 747 |  | 
|---|
| 748 | } | 
|---|
| 749 | numdr++; | 
|---|
| 750 | delete[] xx; | 
|---|
| 751 | xx=NULL; | 
|---|
| 752 | delete[] yy; | 
|---|
| 753 | yy=NULL; | 
|---|
| 754 | cntcur = cntcur->next; | 
|---|
| 755 | tot++; | 
|---|
| 756 | } | 
|---|
| 757 |  | 
|---|
| 758 | //cout << "PIContourDrawer::Draw  fin de trace des "<<tot<< " polygones "<<endl; | 
|---|
| 759 |  | 
|---|
| 760 | // | 
|---|
| 761 | if(cmap !=NULL)delete cmap; | 
|---|
| 762 |  | 
|---|
| 763 | g->RestoreGraphicAtt(); | 
|---|
| 764 | } | 
|---|
| 765 |  | 
|---|
| 766 | /* --Methode-- */ | 
|---|
| 767 | void PIContourDrawer::UpdateLimits() | 
|---|
| 768 | { | 
|---|
| 769 | // Doit calculer les limites | 
|---|
| 770 |  | 
|---|
| 771 | double xmn = _xmin; | 
|---|
| 772 | double xmx = _xmax; | 
|---|
| 773 | double ymn = _ymin; | 
|---|
| 774 | double ymx = _ymax; | 
|---|
| 775 |  | 
|---|
| 776 | SetLimits(xmn, xmx, ymn, ymx); | 
|---|
| 777 | } | 
|---|
| 778 |  | 
|---|
| 779 |  | 
|---|
| 780 | /* --Methode-- */ | 
|---|
| 781 | void PIContourDrawer::ShowControlWindow(PIBaseWdgGen* wdg) | 
|---|
| 782 | { | 
|---|
| 783 | PICnTools::SetCurrentBaseWdg(wdg); | 
|---|
| 784 | PICnTools::SetCurrentCnDrw(this); | 
|---|
| 785 | PICnTools::ShowPICnTools(); | 
|---|
| 786 | } | 
|---|
| 787 |  | 
|---|
| 788 | //++ | 
|---|
| 789 | void PIContourDrawer::DeactivateControlWindow(PIBaseWdgGen* wdg) | 
|---|
| 790 | // | 
|---|
| 791 | //      Desactivation de la fenetre de controle specialisee | 
|---|
| 792 | //-- | 
|---|
| 793 | { | 
|---|
| 794 | // si wdg != NULL, c'est un Detach (Drawer detache du PIBaseWdg | 
|---|
| 795 | // si wdg == NULL, c'est un delete du PIHisto2D (du PIDrawer) | 
|---|
| 796 |  | 
|---|
| 797 | PICnTools::SetCurrentBaseWdg(NULL); | 
|---|
| 798 | PICnTools::SetCurrentCnDrw(NULL); | 
|---|
| 799 | PICnTools::HidePICnTools(); | 
|---|
| 800 |  | 
|---|
| 801 | return; | 
|---|
| 802 | } | 
|---|
| 803 |  | 
|---|
| 804 |  | 
|---|
| 805 | /* --Methode-- */ | 
|---|
| 806 | bool PIContourDrawer::IsLabelOn() const | 
|---|
| 807 | { | 
|---|
| 808 | return (mLabelOn); | 
|---|
| 809 | } | 
|---|
| 810 |  | 
|---|
| 811 | bool PIContourDrawer::IsLineOn() const | 
|---|
| 812 | { | 
|---|
| 813 | return (mLineOn); | 
|---|
| 814 | } | 
|---|
| 815 |  | 
|---|
| 816 | bool PIContourDrawer::IsMarkOn() const | 
|---|
| 817 | { | 
|---|
| 818 | return (mMarkOn); | 
|---|
| 819 | } | 
|---|
| 820 |  | 
|---|
| 821 | void PIContourDrawer::SetLabelOn(bool state) | 
|---|
| 822 | { | 
|---|
| 823 | mLabelOn = state; | 
|---|
| 824 | } | 
|---|
| 825 |  | 
|---|
| 826 | void PIContourDrawer::SetMarkOn(bool state){ | 
|---|
| 827 | mMarkOn = state; | 
|---|
| 828 | } | 
|---|
| 829 |  | 
|---|
| 830 | void PIContourDrawer::SetLineOn(bool state){ | 
|---|
| 831 | mLineOn = state; | 
|---|
| 832 | } | 
|---|
| 833 |  | 
|---|
| 834 | void PIContourDrawer::InitAtts(){ | 
|---|
| 835 | mLineOn = true; | 
|---|
| 836 | mMarkOn = false; | 
|---|
| 837 | mLabelOn = false; | 
|---|
| 838 | } | 
|---|
| 839 |  | 
|---|
| 840 | int PIContourDrawer::DecodeOptionString(vector<string> & opt, bool rmdecopt) | 
|---|
| 841 | { | 
|---|
| 842 | // inspire de int PINTuple::DecodeOptionString | 
|---|
| 843 | // OP 11/2002 LAL Orsay | 
|---|
| 844 |  | 
|---|
| 845 | int ndec = opt.size(); | 
|---|
| 846 | if (ndec < 1)  return(0); | 
|---|
| 847 |  | 
|---|
| 848 |  | 
|---|
| 849 | //  cout << " PIDrawer::DecodeOptionString  : ndec = "<< ndec <<endl; | 
|---|
| 850 | // On appelle d'abord le decodage de la classe PIDrawer de laquelle | 
|---|
| 851 | // on herite. (Pas obligatoire) on decode donc ici les attributs de | 
|---|
| 852 | // couleur, fontes ... | 
|---|
| 853 | int ndec1 = PIDrawer::DecodeOptionString(opt, rmdecopt); | 
|---|
| 854 | //cout << " PIDrawer::DecodeOptionString apres PIDrawer::DecodeOptionString : ndec = " | 
|---|
| 855 | //     << ndec1 <<"<>" << ndec <<endl; | 
|---|
| 856 | if( ndec - ndec1 < 1 ) return(ndec1);  // si tout a ete decode | 
|---|
| 857 |  | 
|---|
| 858 | vector<string> udopt;  // On gardera ici les options non decodees | 
|---|
| 859 | int iopt  = 0; | 
|---|
| 860 | ndec = opt.size(); | 
|---|
| 861 | int recalc = 0; | 
|---|
| 862 | for (iopt = 0 ; iopt<ndec ; iopt++){ | 
|---|
| 863 |  | 
|---|
| 864 | string sopt = opt[iopt]; | 
|---|
| 865 | if( sopt.find_first_of("=") != string::npos ){ | 
|---|
| 866 | // options avec = | 
|---|
| 867 | string deb = sopt.substr(0,sopt.find_first_of("=")); | 
|---|
| 868 | // cout << " option avec =  : "<<deb<<" "<<sopt<<endl; | 
|---|
| 869 | if( (deb =="ncont") || (deb =="nc") ){ // # de contours | 
|---|
| 870 | string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos); | 
|---|
| 871 | // cout <<" fin "<<fin<<endl; | 
|---|
| 872 | int nlev = atoi(fin.c_str()); | 
|---|
| 873 | this->SetNLevel(nlev); | 
|---|
| 874 | this->SetCntLevelKind(LEVELS_NUM); | 
|---|
| 875 | recalc =1; | 
|---|
| 876 | }else if(deb=="niv"||deb=="lev"){ // hauteur des niveaux | 
|---|
| 877 | string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos); | 
|---|
| 878 | char * buff = strdup(fin.c_str()); | 
|---|
| 879 | char *tmp; | 
|---|
| 880 | tmp = strtok(buff,","); | 
|---|
| 881 |  | 
|---|
| 882 | if(tmp==NULL){ | 
|---|
| 883 | cerr<< " PICOntourDrawer::DecodeOptionString ERREUR decodage des niveaux impossible " << buff <<endl; | 
|---|
| 884 |  | 
|---|
| 885 | }else { | 
|---|
| 886 |  | 
|---|
| 887 | vector <double> ztmp; | 
|---|
| 888 | while(tmp!=NULL){ | 
|---|
| 889 | ztmp.push_back(atof(tmp)); | 
|---|
| 890 | tmp = strtok(NULL,","); | 
|---|
| 891 | } | 
|---|
| 892 | int nlev = ztmp.size(); | 
|---|
| 893 | // cout << "  PICOntourDrawer::DecodeOptionString "<<nlev<<" niveaux decodes "<<endl; | 
|---|
| 894 | this->SetCntLevelKind(LEVELS_DISCRETE); | 
|---|
| 895 | this->SetNLevel(nlev); | 
|---|
| 896 | this->SetMyLevels(ztmp); | 
|---|
| 897 | recalc =1; | 
|---|
| 898 | } | 
|---|
| 899 | }else if(deb=="lstep" ){ // niveaux incrementaux : args = nombre,depart,pas | 
|---|
| 900 | string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos); | 
|---|
| 901 | char * buff = strdup(fin.c_str()); | 
|---|
| 902 | char *tmp; | 
|---|
| 903 | tmp = strtok(buff,","); | 
|---|
| 904 |  | 
|---|
| 905 | if(tmp==NULL){ | 
|---|
| 906 | cerr<< " PICOntourDrawer::DecodeOptionString ERREUR decodage nvx/incr. impossible " << buff <<endl; | 
|---|
| 907 | }else{ | 
|---|
| 908 |  | 
|---|
| 909 | vector <double> ztmp; | 
|---|
| 910 | while(tmp!=NULL){ | 
|---|
| 911 | ztmp.push_back(atof(tmp)); | 
|---|
| 912 | tmp = strtok(NULL,","); | 
|---|
| 913 | } | 
|---|
| 914 | if(ztmp.size() !=2) { | 
|---|
| 915 | cerr<< " PICOntourDrawer::DecodeOptionString ERREUR nb params incorrect(incr) " << buff <<endl; | 
|---|
| 916 | }else{ | 
|---|
| 917 | vector <double> zlev; | 
|---|
| 918 | zlev.push_back(ztmp[1]); | 
|---|
| 919 | zlev.push_back(ztmp[2]); | 
|---|
| 920 | this->SetCntLevelKind(LEVELS_INCREMENTAL); | 
|---|
| 921 | this->SetNLevel( (int) ztmp[0]); | 
|---|
| 922 | this->SetMyLevels(zlev); | 
|---|
| 923 | recalc=1; | 
|---|
| 924 | } | 
|---|
| 925 | } | 
|---|
| 926 |  | 
|---|
| 927 | }else{ | 
|---|
| 928 | cout<<"PICOntourDrawer::DecodeOptionString ERREUR  option "<<sopt<<" non reconnue "<<endl; | 
|---|
| 929 | ndec--; | 
|---|
| 930 | if (rmdecopt)  udopt.push_back( sopt ); | 
|---|
| 931 | } | 
|---|
| 932 | }else{ //options sans "=" | 
|---|
| 933 | if( sopt == "labon" ) | 
|---|
| 934 | this->SetLabelOn(); | 
|---|
| 935 | else if ( sopt == "laboff" ) | 
|---|
| 936 | this->SetLabelOn(false); | 
|---|
| 937 | else if ( sopt == "autolevels" ) | 
|---|
| 938 | this->SetCntLevelKind(LEVELS_AUTO); | 
|---|
| 939 | else if (sopt == "linear" ){ | 
|---|
| 940 | this->SetCntKind(CONTOUR_KIND_BSPLINE); | 
|---|
| 941 | recalc = 1; | 
|---|
| 942 | } | 
|---|
| 943 | else if (sopt == "bspline" ){ | 
|---|
| 944 | this->SetCntKind(CONTOUR_KIND_BSPLINE); | 
|---|
| 945 | recalc = 1; | 
|---|
| 946 | }else if ((sopt == "3spl" )||(sopt == "cubicspl")) { | 
|---|
| 947 | this->SetCntKind(CONTOUR_KIND_CUBIC_SPL); | 
|---|
| 948 | recalc = 1; | 
|---|
| 949 | } | 
|---|
| 950 | else{ | 
|---|
| 951 | cout<<"PICOntourDrawer::DecodeOptionString ERREUR  option "<<sopt<<" non reconnue "<<endl; | 
|---|
| 952 | ndec--; | 
|---|
| 953 | if (rmdecopt)  udopt.push_back(sopt); | 
|---|
| 954 | } | 
|---|
| 955 | } | 
|---|
| 956 |  | 
|---|
| 957 | }// FIN DE LA BOUCLE SUR LES OPTIONS | 
|---|
| 958 |  | 
|---|
| 959 | if(recalc==1){ | 
|---|
| 960 | // il faut (re)calculer les contours | 
|---|
| 961 | cout << " PICOntourDrawer::DecodeOptionString(re)calcul des contours "<<endl; | 
|---|
| 962 | this->CalcContour(); | 
|---|
| 963 | } | 
|---|
| 964 | this->Refresh(); | 
|---|
| 965 |  | 
|---|
| 966 |  | 
|---|
| 967 | // | 
|---|
| 968 |  | 
|---|
| 969 | // S'il faut supprimer les options decodees, on remplace l'argument opt | 
|---|
| 970 | // par le vecteur des options non decodees. | 
|---|
| 971 | if (rmdecopt)  opt = udopt; | 
|---|
| 972 |  | 
|---|
| 973 | return(ndec+ndec1); | 
|---|
| 974 |  | 
|---|
| 975 | } | 
|---|
| 976 |  | 
|---|
| 977 | // Methode ajoute en Oct 2007 - Reza | 
|---|
| 978 | int PIContourDrawer::OptionToString(vector<string> & opt) const | 
|---|
| 979 | { | 
|---|
| 980 | PIDrawer::OptionToString(opt); | 
|---|
| 981 |  | 
|---|
| 982 | if (GetCntKind()==CONTOUR_KIND_LINEAR)  opt.push_back("linear"); | 
|---|
| 983 | else if (GetCntKind()==CONTOUR_KIND_BSPLINE)  opt.push_back("bspline"); | 
|---|
| 984 | else if (GetCntKind()==CONTOUR_KIND_CUBIC_SPL)  opt.push_back("cubicspl"); | 
|---|
| 985 |  | 
|---|
| 986 | if (IsLabelOn()) opt.push_back("labon"); | 
|---|
| 987 | else opt.push_back("laboff"); | 
|---|
| 988 |  | 
|---|
| 989 | return 1; | 
|---|
| 990 | } | 
|---|
| 991 |  | 
|---|
| 992 | void PIContourDrawer::GetOptionsHelpInfo(string& info) | 
|---|
| 993 | { | 
|---|
| 994 | info += " ---- PIContourDrawer options help info : \n" ; | 
|---|
| 995 | info += " autolevels : automatic selection of levels and number of contours \n"; | 
|---|
| 996 | info += " ncont=nLevel (or nc=NLevel) : sets the number of contour\n"; | 
|---|
| 997 | info += " lev=v1,v2,v3... (or niv=v1,v2,v3...) set the number and levels of contours\n"; | 
|---|
| 998 | info += " lstep=nLev,start,step : define incremental levels \n"; | 
|---|
| 999 | info += " labon/laboff : display of contour level values on/off \n"; | 
|---|
| 1000 | info += " linear/bspline/cubicspl=3spl : select contour kind \n"; | 
|---|
| 1001 | // On recupere ensuite la chaine info de la classe de base | 
|---|
| 1002 | PIDrawer::GetOptionsHelpInfo(info); | 
|---|
| 1003 | return; | 
|---|
| 1004 | } | 
|---|
| 1005 |  | 
|---|
| 1006 |  | 
|---|
| 1007 |  | 
|---|
| 1008 |  | 
|---|