| 1 | // This may look like C code, but it is really -*- C++ -*-
 | 
|---|
| 2 | // Classe d'interface avec le code de GNUplot 
 | 
|---|
| 3 | // pour calculer les contours & classe de trace de contours
 | 
|---|
| 4 | // O. Perdereau
 | 
|---|
| 5 | // LAL (Orsay) / IN2P3-CNRS  DAPNIA/SPP (Saclay) / CEA
 | 
|---|
| 6 | 
 | 
|---|
| 7 | #include "sopnamsp.h"
 | 
|---|
| 8 | #include "machdefs.h"
 | 
|---|
| 9 | #include <stdio.h>
 | 
|---|
| 10 | #include <stdlib.h>
 | 
|---|
| 11 | #include <assert.h>
 | 
|---|
| 12 | #include <iostream>
 | 
|---|
| 13 | #include <math.h>
 | 
|---|
| 14 | 
 | 
|---|
| 15 | #include "histos.h"
 | 
|---|
| 16 | #include "ntuple.h"
 | 
|---|
| 17 | 
 | 
|---|
| 18 | #include "nbtri.h" 
 | 
|---|
| 19 | 
 | 
|---|
| 20 | #include "picntools.h"
 | 
|---|
| 21 | #include "pigncont.h"
 | 
|---|
| 22 | 
 | 
|---|
| 23 | #include <sys/time.h>
 | 
|---|
| 24 | #include <sys/resource.h>
 | 
|---|
| 25 | 
 | 
|---|
| 26 | //++
 | 
|---|
| 27 | // Class        GNUPlotContour
 | 
|---|
| 28 | // Lib          PIGcont
 | 
|---|
| 29 | // include      pigncont.h
 | 
|---|
| 30 | //
 | 
|---|
| 31 | //      Classe d'interface avec le code de GNUplot qui calcule les courbes de niveaux 
 | 
|---|
| 32 | //      GNUplot part d'une grille (structure iso_curve) qui est remplie par les 
 | 
|---|
| 33 | //      createurs 
 | 
|---|
| 34 | //      Les parametres du calcul sont modifiable a partir de la fenetre d'options 
 | 
|---|
| 35 | //      du traceur de contour (classe PIContourDrawer)
 | 
|---|
| 36 | //      Options (reconnues dans un enum t_contour_kind dans GNUplot)
 | 
|---|
| 37 | // 
 | 
|---|
| 38 | //       1) nombre de courbes et et niveaux determines automatiquement par le programme (defaut)
 | 
|---|
| 39 | //          En general, 5 courbes sont tracees LEVELS_AUTO
 | 
|---|
| 40 | // 
 | 
|---|
| 41 | //       2) nombre de niveaux fixe par l'utilisateur. Les niveaux sont equidistants entre 
 | 
|---|
| 42 | //          le min et le max de la surface LEVELS_NUM
 | 
|---|
| 43 | //
 | 
|---|
| 44 | //       3) nombre et hauteurs des niveaux fixes par l'utilisateur. Les niveaux sont passes
 | 
|---|
| 45 | //          dans un tableau LEVELS_DISCRETE
 | 
|---|
| 46 | //
 | 
|---|
| 47 | //       4) nombre niveau min et ecart entre niveaux fixe par l'utilisateur LEVELS_INCREMENTAL
 | 
|---|
| 48 | //         
 | 
|---|
| 49 | //     Les contours sont traces en interpolant entre les points de la grille. 
 | 
|---|
| 50 | //     On peut choisir 3 algorithmes d'interpolation a travers p.ex. les options 
 | 
|---|
| 51 | //     de PIContourDrawer
 | 
|---|
| 52 | //     (enum t_contour_levels_kind ds GNUplot) 
 | 
|---|
| 53 | //
 | 
|---|
| 54 | //       a) interpolation simple CONTOUR_KIND_LINEAR
 | 
|---|
| 55 | //
 | 
|---|
| 56 | //       b) spline cubique       CONTOUR_KIND_CUBIC_SPL
 | 
|---|
| 57 | //
 | 
|---|
| 58 | //       c) B-spline             CONTOUR_KIND_BSPLINE
 | 
|---|
| 59 | //
 | 
|---|
| 60 | //--
 | 
|---|
| 61 | //++
 | 
|---|
| 62 | // Links        Voir aussi
 | 
|---|
| 63 | // PIContourDrawer
 | 
|---|
| 64 | // PICnTools 
 | 
|---|
| 65 | //--
 | 
|---|
| 66 | //++
 | 
|---|
| 67 | // Titre        Constructeurs et Méthodes 
 | 
|---|
| 68 | //--
 | 
|---|
| 69 | //++
 | 
|---|
| 70 | // GNUPlotContour(struct iso_curve * iso) : 
 | 
|---|
| 71 | //         constructeur a partir d'une structure iso_curve
 | 
|---|
| 72 | //         (structure de GNUplot)             
 | 
|---|
| 73 | //--
 | 
|---|
| 74 | 
 | 
|---|
| 75 | 
 | 
|---|
| 76 | GNUPlotContour::GNUPlotContour(struct iso_curve * iso){
 | 
|---|
| 77 |   int k=0;
 | 
|---|
| 78 |   iso1 = iso;
 | 
|---|
| 79 |   struct iso_curve *iso_cur = iso ;
 | 
|---|
| 80 |   struct iso_curve *iso_old;
 | 
|---|
| 81 |   _xmin = 1.e37;
 | 
|---|
| 82 |   _ymin = 1.e37;
 | 
|---|
| 83 |   _xmax = -1.e37;
 | 
|---|
| 84 |   _ymax = -1.e37;
 | 
|---|
| 85 |   _myiso = NULL;
 | 
|---|
| 86 |   _zmin = 1.e37;
 | 
|---|
| 87 |   _zmax = -1.e37;
 | 
|---|
| 88 |   while(iso_cur){
 | 
|---|
| 89 |     k++;
 | 
|---|
| 90 |     iso_cur = iso_cur->next;
 | 
|---|
| 91 |     _ny = iso_cur->p_count;
 | 
|---|
| 92 |     for(int k=0 ; k<_ny ; k++){
 | 
|---|
| 93 |       double xx=iso->points[k].x;
 | 
|---|
| 94 |       double yy=iso->points[k].y;
 | 
|---|
| 95 |       double zz=iso->points[k].z;
 | 
|---|
| 96 |       if(xx<_xmin) _xmin = xx;
 | 
|---|
| 97 |       if(xx>_xmax) _xmax = xx;
 | 
|---|
| 98 |       if(yy<_ymin) _ymin = yy;
 | 
|---|
| 99 |       if(yy>_ymax) _ymax = yy;
 | 
|---|
| 100 |       if(zz<_zmin) _zmin = zz;
 | 
|---|
| 101 |       if(zz>_zmax) _zmax = zz;
 | 
|---|
| 102 | 
 | 
|---|
| 103 |     }
 | 
|---|
| 104 |   }
 | 
|---|
| 105 | 
 | 
|---|
| 106 |   _nx = k;
 | 
|---|
| 107 |   _contours = NULL;
 | 
|---|
| 108 |   My_Levels = NULL;
 | 
|---|
| 109 |   
 | 
|---|
| 110 |   _npolys=-1;  
 | 
|---|
| 111 |   _Dxp =_Dyp =1.;
 | 
|---|
| 112 |   _Exy =_Invy =_Invy = FALSE ;
 | 
|---|
| 113 | 
 | 
|---|
| 114 | }
 | 
|---|
| 115 | 
 | 
|---|
| 116 | 
 | 
|---|
| 117 | //++
 | 
|---|
| 118 | // GNUPlotContour(NTupleInterface *nt,int *nz=NULL,double *z=NULL,double *dz=NULL):
 | 
|---|
| 119 | //         constructeur a partir d'un NTupleInterface 
 | 
|---|
| 120 | //         la structure iso_curve est remplie par le constructeur 
 | 
|---|
| 121 | //Inputs 
 | 
|---|
| 122 | //| NTupleInterface *nt 
 | 
|---|
| 123 | //| double *nz nombre de contours (optionnel)
 | 
|---|
| 124 | //| double *z tabelau avec les niveaux des contours (optionnel)
 | 
|---|
| 125 | //| double *dz increment entre contours (optionnel)                
 | 
|---|
| 126 | //--
 | 
|---|
| 127 | GNUPlotContour::GNUPlotContour(NTupleInterface *nt,int *nz=NULL,double *z=NULL,double *dz=NULL){
 | 
|---|
| 128 |   _xmin = 1.e37;
 | 
|---|
| 129 |   _ymin = 1.e37;
 | 
|---|
| 130 |   _xmax = -1.e37;
 | 
|---|
| 131 |   _ymax = -1.e37;
 | 
|---|
| 132 |   _zmin = 1.e37;
 | 
|---|
| 133 |   _zmax = -1.e37;
 | 
|---|
| 134 |   const char *nom[4]={"x","y","z","niso"};
 | 
|---|
| 135 |   _myiso = new NTuple(4,nom);  
 | 
|---|
| 136 |   //_myiso->Show();
 | 
|---|
| 137 |   float xnt[4];
 | 
|---|
| 138 |   double mn,mx;
 | 
|---|
| 139 | 
 | 
|---|
| 140 |   nt->GetMinMax(0,_xmin,_xmax);
 | 
|---|
| 141 |   nt->GetMinMax(1,_ymin,_ymax);
 | 
|---|
| 142 |   nt->GetMinMax(2,_zmin,_zmax);
 | 
|---|
| 143 | 
 | 
|---|
| 144 |   
 | 
|---|
| 145 |   struct iso_curve *istmp = NULL ;
 | 
|---|
| 146 |   struct iso_curve *iso = NULL ;
 | 
|---|
| 147 |   struct iso_curve *iso_old = NULL ;
 | 
|---|
| 148 |   double x,y;
 | 
|---|
| 149 |   int nen = nt->NbLines();
 | 
|---|
| 150 |   
 | 
|---|
| 151 |   // histo des y
 | 
|---|
| 152 |   for(int k= 0 ; k<1000 ; k++){
 | 
|---|
| 153 |     istmp = iso_alloc(100);
 | 
|---|
| 154 |     iso_free(istmp);
 | 
|---|
| 155 |   }
 | 
|---|
| 156 | 
 | 
|---|
| 157 | #define NUMPTMIN 25
 | 
|---|
| 158 | #define MAXISO 100
 | 
|---|
| 159 | #define MINISO 5
 | 
|---|
| 160 | 
 | 
|---|
| 161 |   Histo prep(_ymin,_ymax,nen);  
 | 
|---|
| 162 |   for(int ix=0 ; ix<nen ; ix++) prep.Add(nt->GetCell(ix,1),1.);
 | 
|---|
| 163 |   Histo Intg = prep;
 | 
|---|
| 164 |   Intg.HInteg(0);
 | 
|---|
| 165 |   //prep.Print();
 | 
|---|
| 166 |   //Intg.Print();
 | 
|---|
| 167 |   float *bin;
 | 
|---|
| 168 |   int *cnt;
 | 
|---|
| 169 | 
 | 
|---|
| 170 |   int niso = sqrt( (double)nen);
 | 
|---|
| 171 |   bin = new float[niso+1];
 | 
|---|
| 172 |   cnt = new int[niso+1];
 | 
|---|
| 173 | 
 | 
|---|
| 174 |   int i;
 | 
|---|
| 175 |   for(i=0 ; i<niso ; i++){    
 | 
|---|
| 176 |     bin[i] = prep.BinHighEdge(prep.BinPercent( ((double)i)/(double)niso));
 | 
|---|
| 177 |     cnt[i] = Intg(prep.BinPercent( ((double)i)/(double)niso)); 
 | 
|---|
| 178 |   }
 | 
|---|
| 179 | 
 | 
|---|
| 180 |   bin[niso]=_ymax;
 | 
|---|
| 181 |   
 | 
|---|
| 182 |   cnt[niso] = prep.NEntries();
 | 
|---|
| 183 |   int numx = 0;
 | 
|---|
| 184 |   int numi = 9999;
 | 
|---|
| 185 |   for(i=0;i<niso ; i++){
 | 
|---|
| 186 |     int numy = cnt[i+1]-cnt[i];
 | 
|---|
| 187 |     
 | 
|---|
| 188 |     if(numy>0){
 | 
|---|
| 189 |       numx = numx>numy ? numx : numy ;
 | 
|---|
| 190 |       numi = numy>numi ? numi : numy ;
 | 
|---|
| 191 |     }
 | 
|---|
| 192 |   }
 | 
|---|
| 193 | 
 | 
|---|
| 194 |   
 | 
|---|
| 195 |   if (numi<=0) {
 | 
|---|
| 196 |     
 | 
|---|
| 197 |     return;
 | 
|---|
| 198 |   }
 | 
|---|
| 199 |   _nx = 0;
 | 
|---|
| 200 |   
 | 
|---|
| 201 |   for(i=0;i<niso ; i++){
 | 
|---|
| 202 |     double ymi = bin[i];
 | 
|---|
| 203 |     double ymx = bin[i+1];
 | 
|---|
| 204 |     int numy = cnt[i+1]-cnt[i];
 | 
|---|
| 205 |     
 | 
|---|
| 206 |     if(numy<=0) continue;
 | 
|---|
| 207 |     double *xp;
 | 
|---|
| 208 |     xp = new double[numy];
 | 
|---|
| 209 |     
 | 
|---|
| 210 |     int *indx;
 | 
|---|
| 211 |     indx = new int[numy];
 | 
|---|
| 212 | 
 | 
|---|
| 213 |     istmp = iso_alloc(numy) ; // structure temporaire 
 | 
|---|
| 214 |     
 | 
|---|
| 215 |     int ip=0;
 | 
|---|
| 216 |     int ix;
 | 
|---|
| 217 |     for(ix=0 ; ix<nen ; ix++){
 | 
|---|
| 218 |       
 | 
|---|
| 219 |       if(nt->GetCell(ix,1)>=ymi&&nt->GetCell(ix,1)<ymx){
 | 
|---|
| 220 |         
 | 
|---|
| 221 | 
 | 
|---|
| 222 |         istmp->points[ip].type = INRANGE;
 | 
|---|
| 223 |         istmp->points[ip].x = nt->GetCell(ix,0);
 | 
|---|
| 224 |         istmp->points[ip].y = nt->GetCell(ix,1);
 | 
|---|
| 225 |         istmp->points[ip].z = nt->GetCell(ix,2);
 | 
|---|
| 226 |         indx[ip] = ip;
 | 
|---|
| 227 |         xp[ip++] = nt->GetCell(ix,0);
 | 
|---|
| 228 |       }      
 | 
|---|
| 229 |     }
 | 
|---|
| 230 |     
 | 
|---|
| 231 |     // tri des points de l'iso_curve 
 | 
|---|
| 232 |     //
 | 
|---|
| 233 |     istmp->p_count = ip;
 | 
|---|
| 234 |     
 | 
|---|
| 235 |     tri_double(xp,indx,ip);
 | 
|---|
| 236 |     
 | 
|---|
| 237 |     // remplissage structure finale 
 | 
|---|
| 238 |     
 | 
|---|
| 239 |     iso = iso_alloc(numx) ;
 | 
|---|
| 240 |     if( _nx == 0 ) iso1 = iso; //premiere structure remplie 
 | 
|---|
| 241 |     if (iso_old) iso_old->next = iso;
 | 
|---|
| 242 |     for(ix=0 ; ix<numy   ; ix++){
 | 
|---|
| 243 |       int jx = indx[ix];
 | 
|---|
| 244 |     
 | 
|---|
| 245 |       
 | 
|---|
| 246 |       iso->points[ix].type = INRANGE ;
 | 
|---|
| 247 |       iso->points[ix].x = istmp->points[jx].x ;
 | 
|---|
| 248 |       iso->points[ix].y = istmp->points[jx].y ;
 | 
|---|
| 249 |       iso->points[ix].z = istmp->points[jx].z ;
 | 
|---|
| 250 |       xnt[0] = iso->points[ix].x;
 | 
|---|
| 251 |       xnt[1] = iso->points[ix].y;
 | 
|---|
| 252 |       xnt[2] = iso->points[ix].z;
 | 
|---|
| 253 |       xnt[3] = _nx;
 | 
|---|
| 254 |       //cout << " fill avec "<<xnt[0]<<"  "<<xnt[1] <<" "<<xnt[2] << " "<<xnt[3]<<endl;
 | 
|---|
| 255 |       // _myiso->Show();
 | 
|---|
| 256 |  
 | 
|---|
| 257 |       _myiso->Fill(xnt);
 | 
|---|
| 258 |     }
 | 
|---|
| 259 |     //cout << " completion "<<ip<<" =>> "<<numx<<endl;
 | 
|---|
| 260 |     // on complete 
 | 
|---|
| 261 |     for(ix=ip; ix<numx ; ix++ ){
 | 
|---|
| 262 |       int jmx = indx[ip-1];
 | 
|---|
| 263 |       iso->points[ix].type = INRANGE ;
 | 
|---|
| 264 |       iso->points[ix].x = istmp->points[jmx].x ;
 | 
|---|
| 265 |       iso->points[ix].y = istmp->points[jmx].y ;
 | 
|---|
| 266 |       iso->points[ix].z = istmp->points[jmx].z ;
 | 
|---|
| 267 |       xnt[0] = iso->points[ix].x;
 | 
|---|
| 268 |       xnt[1] = iso->points[ix].y;
 | 
|---|
| 269 |       xnt[2] = iso->points[ix].z;
 | 
|---|
| 270 |       xnt[3] = _nx;
 | 
|---|
| 271 |       //cout << " fill avec "<<xnt[0]<<"  "<<xnt[1] <<" "<<xnt[2] << " "<<xnt[3]<<endl;
 | 
|---|
| 272 |       _myiso->Fill(xnt);
 | 
|---|
| 273 |       //_myiso->Show();
 | 
|---|
| 274 |     }
 | 
|---|
| 275 |     
 | 
|---|
| 276 |     iso->p_count = numx;
 | 
|---|
| 277 | 
 | 
|---|
| 278 |     iso_old = iso;
 | 
|---|
| 279 |     _nx++;
 | 
|---|
| 280 |     //cout << " destruction structure tempo "<<_nx <<endl;
 | 
|---|
| 281 |     if(istmp){
 | 
|---|
| 282 |       iso_free( istmp );// destruction de la structure temporaire 
 | 
|---|
| 283 |       istmp = NULL;
 | 
|---|
| 284 |     }
 | 
|---|
| 285 |     if(xp){delete[] xp ; xp=NULL;}
 | 
|---|
| 286 |     if(indx) {delete[] indx ; indx = NULL;}
 | 
|---|
| 287 | 
 | 
|---|
| 288 |   }
 | 
|---|
| 289 |   //if(_myiso!=NULL)_myiso->Write("myiso.ppf"); 
 | 
|---|
| 290 |   //cout << " fin du remplissage des iso_curves xmin,max "<< _xmin<<","<<_xmax<<" ymin,max "<<_ymin<<","<<_ymax<<endl;
 | 
|---|
| 291 |   _contours = NULL;
 | 
|---|
| 292 |   My_Levels = NULL;
 | 
|---|
| 293 |   _npolys=-1;  
 | 
|---|
| 294 |   Contour_Levels_kind = LEVELS_AUTO ;
 | 
|---|
| 295 |   Contour_kind = CONTOUR_KIND_LINEAR ;
 | 
|---|
| 296 |   set_contour_kind(Contour_kind);
 | 
|---|
| 297 |   Contour_Levels = 5;
 | 
|---|
| 298 |   set_contour_levels(Contour_Levels);
 | 
|---|
| 299 |   set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 300 |   
 | 
|---|
| 301 |  
 | 
|---|
| 302 |   if(dz!=NULL){
 | 
|---|
| 303 |     My_Levels = new double[2];
 | 
|---|
| 304 |     Contour_Levels = *nz;
 | 
|---|
| 305 |     My_Levels[0] = *z ;
 | 
|---|
| 306 |     My_Levels[1] = *dz;
 | 
|---|
| 307 |     Contour_Levels_kind = LEVELS_INCREMENTAL ;
 | 
|---|
| 308 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 309 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 310 |     set_contour_levels_list(My_Levels);//,2);
 | 
|---|
| 311 | 
 | 
|---|
| 312 |   }else  if(nz!=NULL){
 | 
|---|
| 313 |     
 | 
|---|
| 314 |     Contour_Levels = *nz;
 | 
|---|
| 315 |     Contour_Levels_kind = LEVELS_NUM ;
 | 
|---|
| 316 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 317 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 318 |   }
 | 
|---|
| 319 |   
 | 
|---|
| 320 | }
 | 
|---|
| 321 | 
 | 
|---|
| 322 | //++
 | 
|---|
| 323 | // GNUPlotContour(P2DArrayAdapter*arr,int *nz=NULL,double *z=NULL,double *dz=NULL):
 | 
|---|
| 324 | //         constructeur a partir d'un P2DArrayAdapter
 | 
|---|
| 325 | //         la structure iso_curve est remplie par le constructeur 
 | 
|---|
| 326 | //Inputs 
 | 
|---|
| 327 | //| P2DArrayAdapter* arr 
 | 
|---|
| 328 | //| double *nz nombre de contours (optionnel)
 | 
|---|
| 329 | //| double *z tabelau avec les niveaux des contours (optionnel)
 | 
|---|
| 330 | //| double *dz increment entre contours (optionnel)                
 | 
|---|
| 331 | //--
 | 
|---|
| 332 | 
 | 
|---|
| 333 | GNUPlotContour::GNUPlotContour(P2DArrayAdapter* arr,int *nz=NULL,double *z=NULL,double *dz=NULL){
 | 
|---|
| 334 |   _xmin = 1.e37;
 | 
|---|
| 335 |   _ymin = 1.e37;
 | 
|---|
| 336 |   _xmax = -1.e37;
 | 
|---|
| 337 |   _ymax = -1.e37;
 | 
|---|
| 338 |   _zmin = 1.e37;
 | 
|---|
| 339 |   _zmax = -1.e37;
 | 
|---|
| 340 |   // _nx = arr->XSize()-1;
 | 
|---|
| 341 |   // _ny = arr->YSize()-1;
 | 
|---|
| 342 |    _nx = arr->XSize()  ;
 | 
|---|
| 343 |    _ny = arr->YSize()  ;
 | 
|---|
| 344 |    //cout << " size x,y "<<_nx<<" , "<<_ny <<endl;
 | 
|---|
| 345 |    const char *nom[4]={"x","y","z","niso"};
 | 
|---|
| 346 |    
 | 
|---|
| 347 |    _myiso = new NTuple(4,nom);  
 | 
|---|
| 348 |    float xnt[4];
 | 
|---|
| 349 |    struct iso_curve *iso =NULL ;
 | 
|---|
| 350 |    struct iso_curve *iso_old =NULL ;
 | 
|---|
| 351 |    double x,y;
 | 
|---|
| 352 |    // Calcul de la taille en X et en Y d'un pixel
 | 
|---|
| 353 |    double dxp, dyp;
 | 
|---|
| 354 |    double x1,y1;
 | 
|---|
| 355 |    arr->XYfromxy(0,0,x,y);
 | 
|---|
| 356 |    arr->XYfromxy(1,1,x1,y1);
 | 
|---|
| 357 |    _Dxp = (x1-x);
 | 
|---|
| 358 |    _Dyp = (y1-y);
 | 
|---|
| 359 |    double zz;
 | 
|---|
| 360 |    for(int ix=0 ; ix<_nx ; ix++){
 | 
|---|
| 361 |      iso = iso_alloc(_ny) ;
 | 
|---|
| 362 |      if(ix==0) iso1 = iso;
 | 
|---|
| 363 |      if (iso_old) iso_old->next = iso;
 | 
|---|
| 364 |      for(int iy = 0 ; iy<_ny ; iy++){
 | 
|---|
| 365 |        /*i = ix*100+iy;*/
 | 
|---|
| 366 |        arr->XYfromxy(ix,iy,x,y);
 | 
|---|
| 367 | 
 | 
|---|
| 368 |        iso->points[iy].type = INRANGE;
 | 
|---|
| 369 |        iso->points[iy].x = x + _Dxp/2.;
 | 
|---|
| 370 |        iso->points[iy].y = y + _Dyp/2.;
 | 
|---|
| 371 |        zz=arr->Value(ix,iy);
 | 
|---|
| 372 |        iso->points[iy].z = zz;
 | 
|---|
| 373 |        //iso->points[iy].z = ((x-25)*(x-25) + (y-25)*(y-25))*.05 ;
 | 
|---|
| 374 |        if(x <_xmin) _xmin = x;
 | 
|---|
| 375 |        if(x >_xmax) _xmax = x;
 | 
|---|
| 376 |        if(y <_ymin) _ymin = y;
 | 
|---|
| 377 |        if(y >_ymax) _ymax = y;
 | 
|---|
| 378 |        if(zz <_zmin) _zmin = zz;
 | 
|---|
| 379 |        if(zz >_zmax) _zmax = zz;
 | 
|---|
| 380 |        //printf("ix=%d iy=%d x=%f y=%f z=%f \n",ix,iy,iso->points[iy].x,iso->points[iy].y,iso->points[iy].z);
 | 
|---|
| 381 |        xnt[0] = iso->points[iy].x;
 | 
|---|
| 382 |        xnt[1] = iso->points[iy].y;
 | 
|---|
| 383 |        xnt[2] = iso->points[iy].z;
 | 
|---|
| 384 |        xnt[3] = _nx;
 | 
|---|
| 385 | 
 | 
|---|
| 386 |        _myiso->Fill(xnt);
 | 
|---|
| 387 |      }
 | 
|---|
| 388 |      iso->p_count = _ny;
 | 
|---|
| 389 |      iso_old = iso;
 | 
|---|
| 390 |      /*printf(" remplissage %lx old %lx old next %lx \n",iso,iso_old,iso->next,iso_old->next);*/
 | 
|---|
| 391 |      /*iso->next = iso ;*/
 | 
|---|
| 392 |    }
 | 
|---|
| 393 |    //cout << " fin du remplissage des iso_curves xmin,max "<< _xmin<<","<<_xmax<<" ymin,max "<<_ymin<<","<<_ymax<<endl;
 | 
|---|
| 394 |    _contours = NULL;
 | 
|---|
| 395 |    My_Levels = NULL;
 | 
|---|
| 396 |   _npolys=-1;  
 | 
|---|
| 397 |   Contour_kind = CONTOUR_KIND_LINEAR ;
 | 
|---|
| 398 |   set_contour_kind(Contour_kind);
 | 
|---|
| 399 |   Contour_Levels_kind = LEVELS_AUTO ;
 | 
|---|
| 400 |   Contour_Levels = 5;
 | 
|---|
| 401 |   set_contour_levels(Contour_Levels);
 | 
|---|
| 402 |   set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 403 |   
 | 
|---|
| 404 | 
 | 
|---|
| 405 |   if(dz!=NULL){
 | 
|---|
| 406 |     My_Levels = new double[2];
 | 
|---|
| 407 |     Contour_Levels = *nz;
 | 
|---|
| 408 |     My_Levels[0] = *z ;
 | 
|---|
| 409 |     My_Levels[1] = *dz;
 | 
|---|
| 410 |     Contour_Levels_kind = LEVELS_INCREMENTAL ;
 | 
|---|
| 411 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 412 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 413 |     set_contour_levels_list(My_Levels);//,2);
 | 
|---|
| 414 | 
 | 
|---|
| 415 |   }else  if(nz!=NULL){
 | 
|---|
| 416 |     Contour_Levels = *nz;
 | 
|---|
| 417 |     Contour_Levels_kind = LEVELS_NUM ;
 | 
|---|
| 418 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 419 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 420 |   }
 | 
|---|
| 421 |   
 | 
|---|
| 422 | }
 | 
|---|
| 423 | 
 | 
|---|
| 424 | 
 | 
|---|
| 425 | //++
 | 
|---|
| 426 | // ~GNUPlotContour()
 | 
|---|
| 427 | //          
 | 
|---|
| 428 | //       Destructeur        
 | 
|---|
| 429 | //
 | 
|---|
| 430 | //--
 | 
|---|
| 431 | GNUPlotContour::~GNUPlotContour(){
 | 
|---|
| 432 |   //cout << " destructeur de GNUPlotContour "<<endl;
 | 
|---|
| 433 |   
 | 
|---|
| 434 |  struct iso_curve *iso_cur;
 | 
|---|
| 435 |  struct iso_curve *iso_nx;
 | 
|---|
| 436 |  iso_cur = iso1;
 | 
|---|
| 437 |  
 | 
|---|
| 438 |   while(iso_cur){
 | 
|---|
| 439 |     // cout << " ~GNUPlotContour() : destruction de  iso1 "<< iso_cur << endl;
 | 
|---|
| 440 |    iso_nx = iso_cur->next;  
 | 
|---|
| 441 |    iso_free(iso_cur);iso_cur = NULL;
 | 
|---|
| 442 |    
 | 
|---|
| 443 |    iso_cur = iso_nx;
 | 
|---|
| 444 |    
 | 
|---|
| 445 |    }
 | 
|---|
| 446 |  
 | 
|---|
| 447 |  iso1 = NULL;
 | 
|---|
| 448 |  
 | 
|---|
| 449 |  struct gnuplot_contours *cntcur = _contours;
 | 
|---|
| 450 |  /*****
 | 
|---|
| 451 |  struct gnuplot_contours *cntold;
 | 
|---|
| 452 | 
 | 
|---|
| 453 |  while(cntcur) { 
 | 
|---|
| 454 |    //cout << " ~GNUPlotContour() : destruction de _contours" << _contours <<endl; 
 | 
|---|
| 455 |    cntold = cntcur; 
 | 
|---|
| 456 |    cntcur = cntold->next; 
 | 
|---|
| 457 |    gp_free(cntold); 
 | 
|---|
| 458 |    cntold=NULL; 
 | 
|---|
| 459 |  }  
 | 
|---|
| 460 |  *******/
 | 
|---|
| 461 |  contour_free(cntcur);
 | 
|---|
| 462 |  _contours = NULL;
 | 
|---|
| 463 | 
 | 
|---|
| 464 |  if(My_Levels) {
 | 
|---|
| 465 |    //cout << " ~GNUPlotContour() : destruction de MyLevels "<<My_Levels <<endl;
 | 
|---|
| 466 |    delete[] My_Levels; My_Levels=NULL;}
 | 
|---|
| 467 | 
 | 
|---|
| 468 |  if(_myiso!=NULL){ delete _myiso; _myiso=NULL;}
 | 
|---|
| 469 | 
 | 
|---|
| 470 | } 
 | 
|---|
| 471 | 
 | 
|---|
| 472 | 
 | 
|---|
| 473 | //++
 | 
|---|
| 474 | // void CalcContour()
 | 
|---|
| 475 | //      Methode de calcul des courbes de niveaux 
 | 
|---|
| 476 | //      par appel a la routine de GNUplot 
 | 
|---|
| 477 | //
 | 
|---|
| 478 | //--
 | 
|---|
| 479 | void GNUPlotContour::CalcContour(){
 | 
|---|
| 480 |   //cout << " GNUPlotContour::CalcContour(): determination des contours "<<endl;
 | 
|---|
| 481 | 
 | 
|---|
| 482 |  struct rusage r_usage;
 | 
|---|
| 483 |  int rcus;
 | 
|---|
| 484 | 
 | 
|---|
| 485 |  set_contour_kind(Contour_kind);
 | 
|---|
| 486 |  if(Contour_Levels_kind == LEVELS_INCREMENTAL){
 | 
|---|
| 487 |     
 | 
|---|
| 488 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 489 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 490 |     //free_contour_levels_list();
 | 
|---|
| 491 |     set_contour_levels_list(My_Levels);//,2);
 | 
|---|
| 492 | 
 | 
|---|
| 493 |   }else  if(Contour_Levels_kind == LEVELS_DISCRETE ){
 | 
|---|
| 494 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 495 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 496 |     //free_contour_levels_list();
 | 
|---|
| 497 |     set_contour_levels_list(My_Levels);//,Contour_Levels);
 | 
|---|
| 498 |     
 | 
|---|
| 499 |   }else  if(Contour_Levels_kind == LEVELS_NUM ){
 | 
|---|
| 500 |     
 | 
|---|
| 501 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 502 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 503 |   }else if(Contour_Levels_kind == LEVELS_AUTO){
 | 
|---|
| 504 |     Contour_Levels = 5;
 | 
|---|
| 505 |     set_contour_levels(Contour_Levels);
 | 
|---|
| 506 |     set_contour_levels_kind(Contour_Levels_kind);
 | 
|---|
| 507 |   }
 | 
|---|
| 508 | 
 | 
|---|
| 509 |  
 | 
|---|
| 510 |  //rcus = getrusage( RUSAGE_SELF , &r_usage);
 | 
|---|
| 511 | 
 | 
|---|
| 512 |  //if(rcus==0) 
 | 
|---|
| 513 |  //  cout << " rusage -> "<<  r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl;
 | 
|---|
| 514 |  //else
 | 
|---|
| 515 |  //  perror("1er appel");
 | 
|---|
| 516 | 
 | 
|---|
| 517 |  if(_contours) {
 | 
|---|
| 518 |    //cout << " GNUPlotContour::CalcContour(): destruction des contours "<<_contours<<endl;
 | 
|---|
| 519 |    struct gnuplot_contours *cntcur = _contours;
 | 
|---|
| 520 |    /******
 | 
|---|
| 521 |    struct gnuplot_contours *cntold; 
 | 
|---|
| 522 |    while(cntcur) { 
 | 
|---|
| 523 |    //cout << " GNUPlotContour::CalcContour(): destruction des contours "<< cntcur<<endl; 
 | 
|---|
| 524 |      cntold = cntcur; 
 | 
|---|
| 525 |      cntcur = cntold->next; 
 | 
|---|
| 526 |      gp_free(cntold); 
 | 
|---|
| 527 |      cntold = NULL; 
 | 
|---|
| 528 |    } 
 | 
|---|
| 529 |    ******/
 | 
|---|
| 530 |    contour_free(cntcur);
 | 
|---|
| 531 |    _contours = NULL;
 | 
|---|
| 532 |    
 | 
|---|
| 533 |  }
 | 
|---|
| 534 | 
 | 
|---|
| 535 |  //struct gnuplot_contours *cntcur; 
 | 
|---|
| 536 |  //struct gnuplot_contours *cntold;
 | 
|---|
| 537 |  
 | 
|---|
| 538 | 
 | 
|---|
| 539 |  //rcus = getrusage( RUSAGE_SELF , &r_usage);
 | 
|---|
| 540 |  //if(rcus==0) 
 | 
|---|
| 541 |  //  cout << " rusage -> "<< r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl;
 | 
|---|
| 542 |  //else
 | 
|---|
| 543 |  //  perror("2d appel");
 | 
|---|
| 544 | 
 | 
|---|
| 545 | 
 | 
|---|
| 546 |  _contours = contour (_nx,iso1);
 | 
|---|
| 547 |  
 | 
|---|
| 548 | 
 | 
|---|
| 549 |  //rcus = getrusage( RUSAGE_SELF , &r_usage);
 | 
|---|
| 550 |  //if(rcus==0) 
 | 
|---|
| 551 |  //  cout << " rusage -> "<<  r_usage.ru_maxrss <<" , "<< r_usage.ru_ixrss <<" , "<< r_usage.ru_ixrss <<endl;
 | 
|---|
| 552 |  //else
 | 
|---|
| 553 |  //  perror("3ieme appel");
 | 
|---|
| 554 | 
 | 
|---|
| 555 |  //free_contour_levels_list();
 | 
|---|
| 556 |  
 | 
|---|
| 557 |  
 | 
|---|
| 558 | }
 | 
|---|
| 559 | //++
 | 
|---|
| 560 | // void SetMyLevels(double *ptr,int k)
 | 
|---|
| 561 | //      Setting du tableau des niveaux des contours 
 | 
|---|
| 562 | //Inputs      
 | 
|---|
| 563 | //| int k : nombre de niveaux 
 | 
|---|
| 564 | //| double *ptr : adresse du tableau des niveaux 
 | 
|---|
| 565 | //--
 | 
|---|
| 566 | void 
 | 
|---|
| 567 | GNUPlotContour::SetMyLevels(double *ptr,int k){
 | 
|---|
| 568 |   
 | 
|---|
| 569 |   if(My_Levels!=NULL) delete My_Levels;
 | 
|---|
| 570 |   My_Levels = new double[k];
 | 
|---|
| 571 |   for(int i=0 ; i<k ; i++)My_Levels[i] = ptr[i];
 | 
|---|
| 572 | }
 | 
|---|
| 573 | //++
 | 
|---|
| 574 | // void SetMyLevels(vector<double>vec)
 | 
|---|
| 575 | //      Setting du tableau des niveaux des contours 
 | 
|---|
| 576 | //Inputs      
 | 
|---|
| 577 | //| 
 | 
|---|
| 578 | //| vector <double> vec  : vecteur des niveaux 
 | 
|---|
| 579 | //--
 | 
|---|
| 580 | void 
 | 
|---|
| 581 | GNUPlotContour::SetMyLevels(vector <double> vec){
 | 
|---|
| 582 |   
 | 
|---|
| 583 |   if(My_Levels!=NULL) delete My_Levels;
 | 
|---|
| 584 |   int sz = vec.size();
 | 
|---|
| 585 |   assert (sz>0);
 | 
|---|
| 586 | 
 | 
|---|
| 587 |   My_Levels = new double[sz];
 | 
|---|
| 588 |   for(int i=0 ; i<sz ; i++)
 | 
|---|
| 589 |     My_Levels[i] = vec[i];
 | 
|---|
| 590 | }
 | 
|---|
| 591 | 
 | 
|---|
| 592 | //++
 | 
|---|
| 593 | // Class        PIContourDrawer
 | 
|---|
| 594 | // Lib          PIGcont
 | 
|---|
| 595 | // include      pigncont.h
 | 
|---|
| 596 | // 
 | 
|---|
| 597 | //      Classe de traceur de contour qui herite de PIDrawer et de GNUPlotContour 
 | 
|---|
| 598 | //      elle gere les options graphiques generales (couleurs, lignes, fontes,...)
 | 
|---|
| 599 | //      les contours peuvent etre traces avec des lignes ou des markers
 | 
|---|
| 600 | //      on peut afficher les valeurs des niveaux des contours
 | 
|---|
| 601 | //      on peut demander a utiliser une table de couleur 
 | 
|---|
| 602 | //      tout ca a travers la fenetre de controle associee (PICnTools) 
 | 
|---|
| 603 | //
 | 
|---|
| 604 | //--
 | 
|---|
| 605 | //++
 | 
|---|
| 606 | // Links        Parents
 | 
|---|
| 607 | // PIDrawer
 | 
|---|
| 608 | // GNUPlotContour
 | 
|---|
| 609 | //-- 
 | 
|---|
| 610 | //++
 | 
|---|
| 611 | // Links        Voir aussi
 | 
|---|
| 612 | // PICnTools 
 | 
|---|
| 613 | //--
 | 
|---|
| 614 | //++
 | 
|---|
| 615 | // Titre        Constructeurs et Méthodes 
 | 
|---|
| 616 | //--
 | 
|---|
| 617 | //++
 | 
|---|
| 618 | // PIContourDrawer(P2DArrayAdapter* arr,bool autodel,int *nz,double *z0,double *dz )
 | 
|---|
| 619 | // Constructeur a partir d'un P2DArrayAdapter* - voir le createur de GNUPlotContour
 | 
|---|
| 620 | // 
 | 
|---|
| 621 | //--
 | 
|---|
| 622 | 
 | 
|---|
| 623 | PIContourDrawer::PIContourDrawer(P2DArrayAdapter* arr,bool autodel,int *nz,double *z0,double *dz )
 | 
|---|
| 624 |   :GNUPlotContour(arr,nz,z0,dz)
 | 
|---|
| 625 | 
 | 
|---|
| 626 | {
 | 
|---|
| 627 |   _arr = arr;
 | 
|---|
| 628 |   _nti = NULL;
 | 
|---|
| 629 |   _nz=5;
 | 
|---|
| 630 |   if(nz!=NULL)_nz = *nz;
 | 
|---|
| 631 |   _autodel = autodel;
 | 
|---|
| 632 | 
 | 
|---|
| 633 |   // This drawer has specific control tools 
 | 
|---|
| 634 |   mFgSpecContWind = true;
 | 
|---|
| 635 |   InitAtts();
 | 
|---|
| 636 | }
 | 
|---|
| 637 | 
 | 
|---|
| 638 | //++
 | 
|---|
| 639 | // PIContourDrawer(NTupleInterface* nti,bool autodel,int *nz,double *z0,double *dz )
 | 
|---|
| 640 | // Constructeur a partir d'un NTupleInterface*  - voir le createur de GNUPlotContour
 | 
|---|
| 641 | // 
 | 
|---|
| 642 | //--
 | 
|---|
| 643 | PIContourDrawer::PIContourDrawer(NTupleInterface* nti,bool autodel,int *nz,double *z0,double *dz )
 | 
|---|
| 644 |   :GNUPlotContour(nti,nz,z0,dz)
 | 
|---|
| 645 | 
 | 
|---|
| 646 | {
 | 
|---|
| 647 |   _arr = NULL;
 | 
|---|
| 648 |   _nti = nti;
 | 
|---|
| 649 |   _nz=5;
 | 
|---|
| 650 |   if(nz!=NULL)_nz = *nz;
 | 
|---|
| 651 |   _autodel = autodel;
 | 
|---|
| 652 |   InitAtts();
 | 
|---|
| 653 | }
 | 
|---|
| 654 | 
 | 
|---|
| 655 | 
 | 
|---|
| 656 | 
 | 
|---|
| 657 | /* --Methode-- */
 | 
|---|
| 658 | PIContourDrawer::~PIContourDrawer()
 | 
|---|
| 659 | {
 | 
|---|
| 660 |   if(_autodel){ 
 | 
|---|
| 661 |     if(_arr!=NULL){delete _arr; _arr=NULL;}
 | 
|---|
| 662 |     if(_nti!=NULL){delete _nti ; _nti=NULL;}
 | 
|---|
| 663 |   }
 | 
|---|
| 664 |   DeactivateControlWindow(NULL);
 | 
|---|
| 665 |   //if (mColorMap!=NULL){delete  mColorMap;  mColorMap=NULL;}
 | 
|---|
| 666 | }
 | 
|---|
| 667 | 
 | 
|---|
| 668 | /* --Methode-- */
 | 
|---|
| 669 | void PIContourDrawer::Draw(PIGraphicUC* g, double xmin, double ymin, double xmax, double ymax)
 | 
|---|
| 670 | {
 | 
|---|
| 671 |   // double xmin, double ymin, double xmax, double ymax LIMITES DE LA ZONE A REFRESHER
 | 
|---|
| 672 |   //PIGrCoord * xx = new PIGrCoord[10];
 | 
|---|
| 673 |   //PIGrCoord * yy = new PIGrCoord[10];
 | 
|---|
| 674 |   PIGrCoord * xx =NULL;
 | 
|---|
| 675 |   PIGrCoord * yy =NULL;
 | 
|---|
| 676 |   PIGrCoord xa;
 | 
|---|
| 677 |   PIGrCoord ya;
 | 
|---|
| 678 |   char buff[64];
 | 
|---|
| 679 |   // On met les bons attributs graphiques
 | 
|---|
| 680 |   //SelGraAtt(g);
 | 
|---|
| 681 |   g->SaveGraphicAtt();
 | 
|---|
| 682 |   struct gnuplot_contours *cntcur;
 | 
|---|
| 683 |   struct gnuplot_contours *cntold;
 | 
|---|
| 684 |   cntcur = _contours;
 | 
|---|
| 685 | 
 | 
|---|
| 686 |   double a,b;
 | 
|---|
| 687 |   int tot=0;
 | 
|---|
| 688 |   bool Invx, Invy, Exy;
 | 
|---|
| 689 |   PIColorMap * cmap = NULL;
 | 
|---|
| 690 |   CMapId mcmapid = GetGraphicAtt().GetColMapId();
 | 
|---|
| 691 |   if(mcmapid !=CMAP_OTHER ){
 | 
|---|
| 692 |     cmap = new PIColorMap(mcmapid);
 | 
|---|
| 693 |   }
 | 
|---|
| 694 |   int numdr = 0;
 | 
|---|
| 695 |   while(cntcur){
 | 
|---|
| 696 |     int npts = cntcur->num_pts ;
 | 
|---|
| 697 |     if(npts<0) continue;
 | 
|---|
| 698 | 
 | 
|---|
| 699 |     xx = new PIGrCoord[npts];
 | 
|---|
| 700 |     yy = new PIGrCoord[npts];
 | 
|---|
| 701 |     double lev = (cntcur->coords)[0].z ;
 | 
|---|
| 702 |     for(int l=0 ; l< npts ; l++){
 | 
|---|
| 703 |       a = (cntcur->coords)[l].x;
 | 
|---|
| 704 |       b = (cntcur->coords)[l].y;
 | 
|---|
| 705 |       
 | 
|---|
| 706 |       xx[l] = a ;
 | 
|---|
| 707 |       yy[l] = b ;
 | 
|---|
| 708 | 
 | 
|---|
| 709 |     }
 | 
|---|
| 710 | 
 | 
|---|
| 711 |     // choix de la couleur 
 | 
|---|
| 712 |     
 | 
|---|
| 713 |     g->SelForeground(GetGraphicAtt().GetFgColor());
 | 
|---|
| 714 |     if(mcmapid !=CMAP_OTHER ){
 | 
|---|
| 715 |       if(_zmax-_zmin!=0){
 | 
|---|
| 716 |         int kc = ((lev - _zmin)/(_zmax-_zmin))*cmap->NCol();    
 | 
|---|
| 717 |         
 | 
|---|
| 718 |         g->SelForeground(*cmap,kc);
 | 
|---|
| 719 |       }
 | 
|---|
| 720 |     }    
 | 
|---|
| 721 |     // traitement des  des markers 
 | 
|---|
| 722 |     if(IsMarkOn()==true){
 | 
|---|
| 723 |       
 | 
|---|
| 724 |       g->SelMarker(GetGraphicAtt().GetMarkerSz(), GetGraphicAtt().GetMarker());
 | 
|---|
| 725 |       g->DrawMarkers(xx,yy,npts);
 | 
|---|
| 726 |     }
 | 
|---|
| 727 |     // traitement des lignes 
 | 
|---|
| 728 |     if(mLineOn==true){
 | 
|---|
| 729 |       
 | 
|---|
| 730 |       g->SelLine(GetGraphicAtt().GetLineAtt());
 | 
|---|
| 731 |       g->DrawPolygon(xx,yy,npts,false);
 | 
|---|
| 732 |     }
 | 
|---|
| 733 |     // traitement des labels     
 | 
|---|
| 734 |     // SIMPLISTE POUR L'INSTANT : UN AFFICHAGE 
 | 
|---|
| 735 |     if(mLabelOn==true){
 | 
|---|
| 736 |       // 
 | 
|---|
| 737 |       
 | 
|---|
| 738 |       char strg[10];
 | 
|---|
| 739 |       sprintf(strg,"%g",lev);
 | 
|---|
| 740 |       PIFont myfont(GetGraphicAtt().GetFont());
 | 
|---|
| 741 |       
 | 
|---|
| 742 |       g->SelFont(myfont);
 | 
|---|
| 743 |       double px,py;
 | 
|---|
| 744 |       px = (cntcur->coords)[0].x+2*(Xmax()-Xmin())/100.;
 | 
|---|
| 745 |       py = (cntcur->coords)[0].y;
 | 
|---|
| 746 |       g->DrawString(px,py,strg, PI_HorizontalCenter&&PI_VerticalCenter );
 | 
|---|
| 747 |       
 | 
|---|
| 748 |     }
 | 
|---|
| 749 |     numdr++;
 | 
|---|
| 750 |     delete[] xx;
 | 
|---|
| 751 |     xx=NULL;
 | 
|---|
| 752 |     delete[] yy;
 | 
|---|
| 753 |     yy=NULL;
 | 
|---|
| 754 |     cntcur = cntcur->next;
 | 
|---|
| 755 |     tot++;
 | 
|---|
| 756 |   }    
 | 
|---|
| 757 |   
 | 
|---|
| 758 |   //cout << "PIContourDrawer::Draw  fin de trace des "<<tot<< " polygones "<<endl; 
 | 
|---|
| 759 |  
 | 
|---|
| 760 |   // 
 | 
|---|
| 761 |   if(cmap !=NULL)delete cmap;
 | 
|---|
| 762 |   
 | 
|---|
| 763 |   g->RestoreGraphicAtt();
 | 
|---|
| 764 | }
 | 
|---|
| 765 | 
 | 
|---|
| 766 | /* --Methode-- */
 | 
|---|
| 767 | void PIContourDrawer::UpdateLimits()
 | 
|---|
| 768 | {
 | 
|---|
| 769 |   // Doit calculer les limites
 | 
|---|
| 770 | 
 | 
|---|
| 771 |   double xmn = _xmin;
 | 
|---|
| 772 |   double xmx = _xmax;  
 | 
|---|
| 773 |   double ymn = _ymin;
 | 
|---|
| 774 |   double ymx = _ymax;
 | 
|---|
| 775 |   
 | 
|---|
| 776 |   SetLimits(xmn, xmx, ymn, ymx);
 | 
|---|
| 777 | }
 | 
|---|
| 778 | 
 | 
|---|
| 779 | 
 | 
|---|
| 780 | /* --Methode-- */
 | 
|---|
| 781 | void PIContourDrawer::ShowControlWindow(PIBaseWdgGen* wdg)
 | 
|---|
| 782 | {
 | 
|---|
| 783 |   PICnTools::SetCurrentBaseWdg(wdg);
 | 
|---|
| 784 |   PICnTools::SetCurrentCnDrw(this);
 | 
|---|
| 785 |   PICnTools::ShowPICnTools();
 | 
|---|
| 786 | }
 | 
|---|
| 787 | 
 | 
|---|
| 788 | //++
 | 
|---|
| 789 | void PIContourDrawer::DeactivateControlWindow(PIBaseWdgGen* wdg)
 | 
|---|
| 790 | //
 | 
|---|
| 791 | //      Desactivation de la fenetre de controle specialisee
 | 
|---|
| 792 | //--
 | 
|---|
| 793 | {
 | 
|---|
| 794 |   // si wdg != NULL, c'est un Detach (Drawer detache du PIBaseWdg
 | 
|---|
| 795 |   // si wdg == NULL, c'est un delete du PIHisto2D (du PIDrawer)
 | 
|---|
| 796 |   
 | 
|---|
| 797 |   PICnTools::SetCurrentBaseWdg(NULL);
 | 
|---|
| 798 |   PICnTools::SetCurrentCnDrw(NULL);
 | 
|---|
| 799 |   PICnTools::HidePICnTools(); 
 | 
|---|
| 800 | 
 | 
|---|
| 801 |   return;
 | 
|---|
| 802 | }
 | 
|---|
| 803 | 
 | 
|---|
| 804 | 
 | 
|---|
| 805 | /* --Methode-- */
 | 
|---|
| 806 | bool PIContourDrawer::IsLabelOn() const
 | 
|---|
| 807 | {
 | 
|---|
| 808 |   return (mLabelOn);
 | 
|---|
| 809 | }
 | 
|---|
| 810 | 
 | 
|---|
| 811 | bool PIContourDrawer::IsLineOn() const
 | 
|---|
| 812 | {
 | 
|---|
| 813 |   return (mLineOn);
 | 
|---|
| 814 | }
 | 
|---|
| 815 | 
 | 
|---|
| 816 | bool PIContourDrawer::IsMarkOn() const
 | 
|---|
| 817 | {
 | 
|---|
| 818 |   return (mMarkOn);
 | 
|---|
| 819 | }
 | 
|---|
| 820 | 
 | 
|---|
| 821 | void PIContourDrawer::SetLabelOn(bool state)
 | 
|---|
| 822 | {
 | 
|---|
| 823 |   mLabelOn = state;
 | 
|---|
| 824 | }
 | 
|---|
| 825 | 
 | 
|---|
| 826 | void PIContourDrawer::SetMarkOn(bool state){
 | 
|---|
| 827 |   mMarkOn = state;
 | 
|---|
| 828 | }
 | 
|---|
| 829 | 
 | 
|---|
| 830 | void PIContourDrawer::SetLineOn(bool state){
 | 
|---|
| 831 |   mLineOn = state;
 | 
|---|
| 832 | }
 | 
|---|
| 833 | 
 | 
|---|
| 834 | void PIContourDrawer::InitAtts(){
 | 
|---|
| 835 |   mLineOn = true;
 | 
|---|
| 836 |   mMarkOn = false;
 | 
|---|
| 837 |   mLabelOn = false;
 | 
|---|
| 838 | }
 | 
|---|
| 839 | 
 | 
|---|
| 840 | int PIContourDrawer::DecodeOptionString(vector<string> & opt, bool rmdecopt)
 | 
|---|
| 841 | {
 | 
|---|
| 842 |   // inspire de int PINTuple::DecodeOptionString
 | 
|---|
| 843 |   // OP 11/2002 LAL Orsay
 | 
|---|
| 844 |   
 | 
|---|
| 845 |   int ndec = opt.size();
 | 
|---|
| 846 |   if (ndec < 1)  return(0);  
 | 
|---|
| 847 | 
 | 
|---|
| 848 | 
 | 
|---|
| 849 |   //  cout << " PIDrawer::DecodeOptionString  : ndec = "<< ndec <<endl;
 | 
|---|
| 850 |   // On appelle d'abord le decodage de la classe PIDrawer de laquelle
 | 
|---|
| 851 |   // on herite. (Pas obligatoire) on decode donc ici les attributs de
 | 
|---|
| 852 |   // couleur, fontes ...
 | 
|---|
| 853 |   int ndec1 = PIDrawer::DecodeOptionString(opt, rmdecopt);
 | 
|---|
| 854 |   //cout << " PIDrawer::DecodeOptionString apres PIDrawer::DecodeOptionString : ndec = "
 | 
|---|
| 855 |   //     << ndec1 <<"<>" << ndec <<endl;
 | 
|---|
| 856 |   if( ndec - ndec1 < 1 ) return(ndec1);  // si tout a ete decode
 | 
|---|
| 857 | 
 | 
|---|
| 858 |   vector<string> udopt;  // On gardera ici les options non decodees
 | 
|---|
| 859 |   int iopt  = 0;
 | 
|---|
| 860 |   ndec = opt.size();
 | 
|---|
| 861 |   int recalc = 0;
 | 
|---|
| 862 |   for (iopt = 0 ; iopt<ndec ; iopt++){
 | 
|---|
| 863 | 
 | 
|---|
| 864 |     string sopt = opt[iopt];
 | 
|---|
| 865 |     if( sopt.find_first_of("=") != string::npos ){
 | 
|---|
| 866 |       // options avec = 
 | 
|---|
| 867 |       string deb = sopt.substr(0,sopt.find_first_of("="));
 | 
|---|
| 868 |       // cout << " option avec =  : "<<deb<<" "<<sopt<<endl;
 | 
|---|
| 869 |       if( (deb =="ncont") || (deb =="nc") ){ // # de contours 
 | 
|---|
| 870 |         string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos);
 | 
|---|
| 871 |         // cout <<" fin "<<fin<<endl;
 | 
|---|
| 872 |         int nlev = atoi(fin.c_str());
 | 
|---|
| 873 |         this->SetNLevel(nlev);
 | 
|---|
| 874 |         this->SetCntLevelKind(LEVELS_NUM);
 | 
|---|
| 875 |         recalc =1;
 | 
|---|
| 876 |       }else if(deb=="niv"||deb=="lev"){ // hauteur des niveaux 
 | 
|---|
| 877 |         string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos);
 | 
|---|
| 878 |         char * buff = strdup(fin.c_str());
 | 
|---|
| 879 |         char *tmp;
 | 
|---|
| 880 |         tmp = strtok(buff,",");
 | 
|---|
| 881 |         
 | 
|---|
| 882 |         if(tmp==NULL){
 | 
|---|
| 883 |            cerr<< " PICOntourDrawer::DecodeOptionString ERREUR decodage des niveaux impossible " << buff <<endl;
 | 
|---|
| 884 |           
 | 
|---|
| 885 |         }else {
 | 
|---|
| 886 |         
 | 
|---|
| 887 |           vector <double> ztmp;
 | 
|---|
| 888 |           while(tmp!=NULL){
 | 
|---|
| 889 |             ztmp.push_back(atof(tmp));
 | 
|---|
| 890 |             tmp = strtok(NULL,",");
 | 
|---|
| 891 |           }
 | 
|---|
| 892 |           int nlev = ztmp.size();
 | 
|---|
| 893 |           // cout << "  PICOntourDrawer::DecodeOptionString "<<nlev<<" niveaux decodes "<<endl; 
 | 
|---|
| 894 |           this->SetCntLevelKind(LEVELS_DISCRETE);
 | 
|---|
| 895 |           this->SetNLevel(nlev); 
 | 
|---|
| 896 |           this->SetMyLevels(ztmp);
 | 
|---|
| 897 |           recalc =1;
 | 
|---|
| 898 |         }
 | 
|---|
| 899 |       }else if(deb=="lstep" ){ // niveaux incrementaux : args = nombre,depart,pas
 | 
|---|
| 900 |         string fin =  sopt.substr(sopt.find_first_of("=")+1 , string::npos);
 | 
|---|
| 901 |         char * buff = strdup(fin.c_str());
 | 
|---|
| 902 |         char *tmp;
 | 
|---|
| 903 |         tmp = strtok(buff,",");
 | 
|---|
| 904 |         
 | 
|---|
| 905 |         if(tmp==NULL){
 | 
|---|
| 906 |           cerr<< " PICOntourDrawer::DecodeOptionString ERREUR decodage nvx/incr. impossible " << buff <<endl;
 | 
|---|
| 907 |         }else{
 | 
|---|
| 908 |           
 | 
|---|
| 909 |           vector <double> ztmp;
 | 
|---|
| 910 |           while(tmp!=NULL){
 | 
|---|
| 911 |             ztmp.push_back(atof(tmp));
 | 
|---|
| 912 |             tmp = strtok(NULL,",");
 | 
|---|
| 913 |           }
 | 
|---|
| 914 |           if(ztmp.size() !=2) {
 | 
|---|
| 915 |             cerr<< " PICOntourDrawer::DecodeOptionString ERREUR nb params incorrect(incr) " << buff <<endl;
 | 
|---|
| 916 |           }else{
 | 
|---|
| 917 |             vector <double> zlev;
 | 
|---|
| 918 |             zlev.push_back(ztmp[1]);
 | 
|---|
| 919 |             zlev.push_back(ztmp[2]);
 | 
|---|
| 920 |             this->SetCntLevelKind(LEVELS_INCREMENTAL);
 | 
|---|
| 921 |             this->SetNLevel( (int) ztmp[0]); 
 | 
|---|
| 922 |             this->SetMyLevels(zlev);
 | 
|---|
| 923 |             recalc=1;
 | 
|---|
| 924 |           }
 | 
|---|
| 925 |         }
 | 
|---|
| 926 | 
 | 
|---|
| 927 |       }else{
 | 
|---|
| 928 |         cout<<"PICOntourDrawer::DecodeOptionString ERREUR  option "<<sopt<<" non reconnue "<<endl;
 | 
|---|
| 929 |         ndec--;
 | 
|---|
| 930 |         if (rmdecopt)  udopt.push_back( sopt );
 | 
|---|
| 931 |       }
 | 
|---|
| 932 |     }else{ //options sans "="
 | 
|---|
| 933 |       if( sopt == "labon" )
 | 
|---|
| 934 |         this->SetLabelOn();
 | 
|---|
| 935 |       else if ( sopt == "laboff" )
 | 
|---|
| 936 |         this->SetLabelOn(false);
 | 
|---|
| 937 |       else if ( sopt == "autolevels" )
 | 
|---|
| 938 |         this->SetCntLevelKind(LEVELS_AUTO);
 | 
|---|
| 939 |       else if (sopt == "linear" ){
 | 
|---|
| 940 |         this->SetCntKind(CONTOUR_KIND_BSPLINE);
 | 
|---|
| 941 |         recalc = 1;
 | 
|---|
| 942 |       }
 | 
|---|
| 943 |       else if (sopt == "bspline" ){
 | 
|---|
| 944 |         this->SetCntKind(CONTOUR_KIND_BSPLINE);
 | 
|---|
| 945 |         recalc = 1;
 | 
|---|
| 946 |       }else if ((sopt == "3spl" )||(sopt == "cubicspl")) {
 | 
|---|
| 947 |         this->SetCntKind(CONTOUR_KIND_CUBIC_SPL);
 | 
|---|
| 948 |         recalc = 1;
 | 
|---|
| 949 |       }
 | 
|---|
| 950 |       else{
 | 
|---|
| 951 |         cout<<"PICOntourDrawer::DecodeOptionString ERREUR  option "<<sopt<<" non reconnue "<<endl;
 | 
|---|
| 952 |         ndec--;
 | 
|---|
| 953 |         if (rmdecopt)  udopt.push_back(sopt);
 | 
|---|
| 954 |       }
 | 
|---|
| 955 |     }
 | 
|---|
| 956 |     
 | 
|---|
| 957 |   }// FIN DE LA BOUCLE SUR LES OPTIONS 
 | 
|---|
| 958 | 
 | 
|---|
| 959 |   if(recalc==1){
 | 
|---|
| 960 |     // il faut (re)calculer les contours 
 | 
|---|
| 961 |     cout << " PICOntourDrawer::DecodeOptionString(re)calcul des contours "<<endl;
 | 
|---|
| 962 |     this->CalcContour(); 
 | 
|---|
| 963 |   }
 | 
|---|
| 964 |   this->Refresh();
 | 
|---|
| 965 | 
 | 
|---|
| 966 |   
 | 
|---|
| 967 |   //
 | 
|---|
| 968 | 
 | 
|---|
| 969 |   // S'il faut supprimer les options decodees, on remplace l'argument opt
 | 
|---|
| 970 |   // par le vecteur des options non decodees.
 | 
|---|
| 971 |   if (rmdecopt)  opt = udopt;
 | 
|---|
| 972 | 
 | 
|---|
| 973 |   return(ndec+ndec1);  
 | 
|---|
| 974 |   
 | 
|---|
| 975 | }
 | 
|---|
| 976 | 
 | 
|---|
| 977 | // Methode ajoute en Oct 2007 - Reza
 | 
|---|
| 978 | int PIContourDrawer::OptionToString(vector<string> & opt) const
 | 
|---|
| 979 | {
 | 
|---|
| 980 |  PIDrawer::OptionToString(opt);
 | 
|---|
| 981 | 
 | 
|---|
| 982 |  if (GetCntKind()==CONTOUR_KIND_LINEAR)  opt.push_back("linear");
 | 
|---|
| 983 |  else if (GetCntKind()==CONTOUR_KIND_BSPLINE)  opt.push_back("bspline");
 | 
|---|
| 984 |  else if (GetCntKind()==CONTOUR_KIND_CUBIC_SPL)  opt.push_back("cubicspl");
 | 
|---|
| 985 | 
 | 
|---|
| 986 |  if (IsLabelOn()) opt.push_back("labon");
 | 
|---|
| 987 |  else opt.push_back("laboff");
 | 
|---|
| 988 | 
 | 
|---|
| 989 |  return 1;
 | 
|---|
| 990 | }
 | 
|---|
| 991 | 
 | 
|---|
| 992 | void PIContourDrawer::GetOptionsHelpInfo(string& info)
 | 
|---|
| 993 | {
 | 
|---|
| 994 |   info += " ---- PIContourDrawer options help info : \n" ;
 | 
|---|
| 995 |   info += " autolevels : automatic selection of levels and number of contours \n"; 
 | 
|---|
| 996 |   info += " ncont=nLevel (or nc=NLevel) : sets the number of contour\n"; 
 | 
|---|
| 997 |   info += " lev=v1,v2,v3... (or niv=v1,v2,v3...) set the number and levels of contours\n"; 
 | 
|---|
| 998 |   info += " lstep=nLev,start,step : define incremental levels \n"; 
 | 
|---|
| 999 |   info += " labon/laboff : display of contour level values on/off \n"; 
 | 
|---|
| 1000 |   info += " linear/bspline/cubicspl=3spl : select contour kind \n"; 
 | 
|---|
| 1001 | // On recupere ensuite la chaine info de la classe de base
 | 
|---|
| 1002 |   PIDrawer::GetOptionsHelpInfo(info);
 | 
|---|
| 1003 |   return;
 | 
|---|
| 1004 | }
 | 
|---|
| 1005 | 
 | 
|---|
| 1006 | 
 | 
|---|
| 1007 | 
 | 
|---|
| 1008 |  
 | 
|---|